CAS 221050-76-6

1-Amino-7-isoquinolinemethanol

Description:

1-Amino-7-isoquinolinemethanol, with the CAS number 221050-76-6, is a chemical compound characterized by its isoquinoline structure, which features a fused bicyclic system comprising a benzene ring and a pyridine ring. This compound contains an amino group (-NH2) and a hydroxymethyl group (-CH2OH) attached to the isoquinoline framework, contributing to its potential biological activity. The presence of the amino group suggests that it may participate in hydrogen bonding and act as a nucleophile in various chemical reactions. Additionally, the hydroxymethyl group can enhance solubility in polar solvents and may influence the compound's pharmacokinetic properties. 1-Amino-7-isoquinolinemethanol may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its structural features may allow for interactions with biological targets, potentially leading to therapeutic applications. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through experimental studies.

Formula: C₁₀H₁₀N₂O

InChI: InChI=1S/C10H10N2O/c11-10-9-5-7(6-13)1-2-8(9)3-4-12-10/h1-5,13H,6H2,(H2,11,12)

InChI key: InChIKey=BRDJELCDPZJVIF-UHFFFAOYSA-N

SMILES: NC=1C2=C(C=CC(CO)=C2)C=CN1

Synonyms:

• 1-Amino-7-isoquinolinemethanol
• 7-Isoquinolinemethanol, 1-amino-
• (1-Aminoisoquinolin-7-yl)methanol

1-AMino-7-isoquinolineMethanol

CAS: 221050-76-6

Formula: C₁₀H₁₀N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 174.1992

Ref: IN-DA00C2GZ

(1-Aminoisoquinolin-7-yl)methanol

CAS: 221050-76-6

(1-Aminoisoquinolin-7-yl)methanol

Purity: 98%

Molecular weight: 174.2g/mol

Ref: 54-OR1032831

(1-Aminoisoquinolin-7-yl)methanol

CAS: 221050-76-6

Purity: >95%

Molecular weight: 174.199

Ref: FT-G14814

(1-AMINOISOQUINOLIN-7-YL)METHANOL

CAS: 221050-76-6

Purity: 98%

Molecular weight: 174.2030029

Ref: 10-F840432