CAS 221050-96-0

Isoquinoline-7-carboxylic acid

Description:

Isoquinoline-7-carboxylic acid is an organic compound characterized by its isoquinoline structure, which consists of a fused benzene and pyridine ring. This compound features a carboxylic acid functional group (-COOH) at the 7-position of the isoquinoline ring, contributing to its acidic properties. Isoquinoline derivatives are known for their diverse biological activities, including potential roles in medicinal chemistry as they can exhibit antimicrobial, anti-inflammatory, and anticancer properties. The presence of the carboxylic acid group enhances its solubility in polar solvents and can facilitate interactions with biological targets. Isoquinoline-7-carboxylic acid may also participate in various chemical reactions, such as esterification and amidation, making it a versatile building block in organic synthesis. Its unique structure and functional groups allow for potential modifications, leading to the development of novel compounds with specific pharmacological activities. As with many isoquinoline derivatives, the study of this compound may provide insights into its applications in drug discovery and development.

Formula: C₁₀H₇NO₂

InChI: InChI=1/C10H7NO2/c12-10(13)8-2-1-7-3-4-11-6-9(7)5-8/h1-6H,(H,12,13)

SMILES: c1cc(cc2cnccc12)C(=O)O

Synonyms:

• 7-Isoquinolinecarboxylic acid

Isoquinoline-7-carboxylic acid

CAS: 221050-96-0

Formula: C₁₀H₇NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 173.1681

Ref: IN-DA003693

Isoquinoline-7-carboxylic acid

CAS: 221050-96-0

Isoquinoline-7-carboxylic acid

Formula: C₁₀H₇NO₂

Purity: ≥95%

Color and Shape: white solid

Molecular weight: 173.17g/mol

Ref: 54-OR48110

Isoquinoline-7-carboxylic acid

CAS: 221050-96-0

Formula: C₁₀H₇NO₂

Purity: 98%

Color and Shape: No data available.

Molecular weight: 173.171

Ref: 10-F220222