CAS 221054-79-1: (+)-Equol
Description:(+)-Equol is a chiral compound classified as a phytoestrogen, primarily derived from the metabolism of soy isoflavones, particularly daidzein, by gut microbiota. It exhibits a molecular structure characterized by a phenolic ring and a hydroxyl group, contributing to its estrogenic activity. This compound is known for its ability to bind to estrogen receptors, potentially influencing various physiological processes, including hormone regulation and bone health. (+)-Equol is recognized for its antioxidant properties and may play a role in reducing the risk of certain diseases, such as hormone-related cancers and cardiovascular conditions. Its stereochemistry is significant, as the (+) enantiomer is the biologically active form, while the (-) form is less active. The compound is soluble in organic solvents and has limited solubility in water, which affects its bioavailability. Research continues to explore its therapeutic potential and the implications of equol production in individuals, as not everyone possesses the gut bacteria necessary for its synthesis from dietary sources.
Formula:C15H14O3
InChI:InChI=1S/C15H14O3/c16-13-4-1-10(2-5-13)12-7-11-3-6-14(17)8-15(11)18-9-12/h1-6,8,12,16-17H,7,9H2/t12-/m0/s1
InChI key:InChIKey=ADFCQWZHKCXPAJ-LBPRGKRZSA-N
SMILES:OC1=CC=C(C=C1)C2COC3=CC(O)=CC=C3C2
- Synonyms:
- (3R)-3,4-Dihydro-3-(4-hydroxyphenyl)-2H-1-benzopyran-7-ol
- (+)-Equol
- 2H-1-Benzopyran-7-ol, 3,4-dihydro-3-(4-hydroxyphenyl)-, (3R)-
- Isoequol
- (R)-Equol
