CAS 221093-41-0
:(8R,13S,16S,17R)-2,4,15,15,16,17-hexadeuterio-13-methyl-7,8,9,11,12,14-hexahydro-6H-cyclopenta[a]phenanthrene-3,16,17-triol
Description:
The chemical substance with the name "(8R,13S,16S,17R)-2,4,15,15,16,17-hexadeuterio-13-methyl-7,8,9,11,12,14-hexahydro-6H-cyclopenta[a]phenanthrene-3,16,17-triol" and CAS number "221093-41-0" is a complex organic compound characterized by its specific stereochemistry and deuteration. It features multiple chiral centers, which contribute to its unique three-dimensional structure and potential biological activity. The presence of hexadeuterio groups indicates that hydrogen atoms in the molecule are replaced with deuterium, a heavier isotope of hydrogen, which can influence the compound's physical and chemical properties, such as stability and reactivity. The compound is likely to exhibit hydrophilic characteristics due to the presence of hydroxyl (-OH) groups, which can engage in hydrogen bonding. Its structural framework, derived from a cyclopenta[a]phenanthrene core, suggests potential applications in fields such as medicinal chemistry or biochemistry, particularly in studies involving steroid-like compounds or as a tracer in metabolic studies. However, specific biological activities and applications would require further investigation.
Formula:C18H18D6O3
InChI:InChI=1/C18H24O3/c1-18-7-6-13-12-5-3-11(19)8-10(12)2-4-14(13)15(18)9-16(20)17(18)21/h3,5,8,13-17,19-21H,2,4,6-7,9H2,1H3/t13?,14-,15?,16+,17+,18+/m1/s1/i3D,8D,9D2,16D,17D
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
16-Epiestriol-d6
CAS:Controlled ProductFormula:C182H6H18O3Color and Shape:NeatMolecular weight:294.42
