CAS 2211-27-0
:4-hydroxy-2-methylnaphthalen-1-yl acetate
Description:
4-Hydroxy-2-methylnaphthalen-1-yl acetate, with the CAS number 2211-27-0, is an organic compound that belongs to the class of naphthalene derivatives. It features a naphthalene ring system substituted with a hydroxyl group and an acetate group, which contributes to its chemical reactivity and potential applications. This compound is typically characterized by its aromatic structure, which imparts stability and unique electronic properties. It is likely to be a solid at room temperature, exhibiting moderate solubility in organic solvents due to its hydrophobic naphthalene core. The presence of the hydroxyl group suggests potential for hydrogen bonding, influencing its physical properties and reactivity. Additionally, the acetate moiety may enhance its reactivity in esterification or transesterification reactions. 4-Hydroxy-2-methylnaphthalen-1-yl acetate may find applications in organic synthesis, as a building block in the production of more complex molecules, or in the development of materials with specific functional properties. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C13H12O3
InChI:InChI=1/C13H12O3/c1-8-7-12(15)10-5-3-4-6-11(10)13(8)16-9(2)14/h3-7,15H,1-2H3
SMILES:Cc1cc(c2ccccc2c1OC(=O)C)O
Synonyms:- 1,4-Naphthalenediol, 2-Methyl-, 1-Acetate
- Menadiol monoacetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

