CAS 2211-33-8
:1-phenylimidazolidine-2,4,5-trione
Description:
1-Phenylimidazolidine-2,4,5-trione, with the CAS number 2211-33-8, is a heterocyclic organic compound characterized by its imidazolidine ring structure, which contains both nitrogen and carbon atoms. This compound features a phenyl group attached to the imidazolidine ring, contributing to its aromatic properties. The presence of the trione functional groups indicates that it has three carbonyl (C=O) functionalities, which can significantly influence its reactivity and stability. Typically, compounds like this may exhibit properties such as being a potential intermediate in organic synthesis or having biological activity, depending on the specific substituents and the overall molecular structure. Its solubility, melting point, and other physical properties would depend on the specific conditions and the presence of solvents or other reagents. As with many nitrogen-containing heterocycles, it may also participate in various chemical reactions, including nucleophilic attacks and condensation reactions, making it of interest in both synthetic and medicinal chemistry.
Formula:C9H6N2O3
InChI:InChI=1/C9H6N2O3/c12-7-8(13)11(9(14)10-7)6-4-2-1-3-5-6/h1-5H,(H,10,12,14)
SMILES:c1ccc(cc1)N1C(=O)C(=NC1=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1-Phenylimidazolidine-2,4,5-trione
CAS:1-Phenylimidazolidine-2,4,5-trione is a natural product with pharmacological properties. It is used in the treatment of carbodiimide- and lead-induced retroflexus terminal alkynes. 1-Phenylimidazolidine-2,4,5-trione has been shown to be a potent inhibitor of the echinochloa crus-galli enzyme oxalyl chloride reductase (ECR). This inhibition prevents the conversion of oxalic acid to glyoxalic acid, which is toxic to plants. 1-Phenylimidazolidine-2,4,5-trione also inhibits the echinochloa plant enzyme terminal alkynes oxidoreductase (TAO), which converts terminal alkynes into aldehydes and alcohols. The pyrimidine derivative has been shown to prevent growth of E. coli in lab tests.
Formula:C9H6N2O3Purity:Min. 95%Molecular weight:190.16 g/mol
