CymitQuimica logo

CAS 221101-61-7

:

(2R)-amino(biphenyl-4-yl)ethanoic acid

Description:
(2R)-amino(biphenyl-4-yl)ethanoic acid, also known as a derivative of phenylalanine, is an amino acid characterized by its biphenyl structure, which contributes to its unique properties. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH), typical of amino acids, allowing it to participate in various biochemical reactions. The biphenyl moiety enhances its hydrophobic characteristics, influencing its solubility and interaction with biological membranes. The stereochemistry indicated by the (2R) designation suggests that it has a specific spatial arrangement, which can affect its biological activity and interactions with enzymes or receptors. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting specific pathways or conditions. Its potential applications could extend to areas such as medicinal chemistry and materials science, where the biphenyl structure may impart desirable electronic or mechanical properties. Overall, (2R)-amino(biphenyl-4-yl)ethanoic acid represents a fascinating intersection of organic chemistry and biochemistry.
Formula:C14H13NO2
InChI:InChI=1/C14H13NO2/c15-13(14(16)17)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9,13H,15H2,(H,16,17)/t13-/m1/s1
InChI key:BMWOGALGPJNHSP-UHFFFAOYSA-N
SMILES:c1ccc(cc1)c1ccc(cc1)[C@H](C(=O)O)N
Synonyms:
  • a-Amino-biphenyl-4-acetic acid
Found 3 products.