CAS 22112-84-1: 5,10,15,20-Tetrakis-(4-aminophenyl)-21,23H-porphyrin
Description:5,10,15,20-Tetrakis-(4-aminophenyl)-21,23H-porphyrin is a synthetic porphyrin compound characterized by its complex cyclic structure, which includes a central metal ion that can coordinate with various metals, enhancing its properties for applications in catalysis, photodynamic therapy, and as a dye. The presence of four 4-aminophenyl groups attached to the porphyrin core significantly increases its solubility in polar solvents and enhances its reactivity due to the amino groups, which can participate in further chemical modifications. This compound exhibits strong absorbance in the visible region of the electromagnetic spectrum, making it useful in photonic applications. Additionally, its ability to form stable complexes with metal ions allows it to serve as a versatile ligand in coordination chemistry. The compound's unique electronic properties, derived from its conjugated system, contribute to its potential use in organic electronics and as a photosensitizer in medical applications. Overall, 5,10,15,20-Tetrakis-(4-aminophenyl)-21,23H-porphyrin is a valuable compound in both research and industrial settings due to its multifunctional characteristics.
Formula:C44H34N8
InChI:InChI=1S/C44H34N8/c45-29-9-1-25(2-10-29)41-33-17-19-35(49-33)42(26-3-11-30(46)12-4-26)37-21-23-39(51-37)44(28-7-15-32(48)16-8-28)40-24-22-38(52-40)43(36-20-18-34(41)50-36)27-5-13-31(47)14-6-27/h1-24,49,52H,45-48H2/b41-33-,41-34?,42-35-,42-37?,43-36-,43-38?,44-39-,44-40?
InChI key:InChIKey=REPFNYFEIOZRLM-VQHGFYMWSA-N
SMILES:N1=C2C=CC1=C(C3=CC=C(N)C=C3)C4=CC=C(N4)C(=C5N=C(C=C5)C(C6=CC=C(N)C=C6)=C7C=CC(N7)=C2C=8C=CC(N)=CC8)C=9C=CC(N)=CC9
- Synonyms:
- 4,4',4'',4'''-Porphyrin-5,10,15,20-Tetrayltetraaniline
- 4,4′,4′′,4′′′-(21H,23H-Porphine-5,10,15,20-tetrayl)tetrakis[benzenamine]
- 5,10,15,20-Tetra(4-aminophenyl)porphyrin
- 5,10,15,20-Tetrakis(4-aminophenyl)-21H,23H-porphine
- 5,10,15,20-Tetrakis(4-aminophenyl)porphine
- 5,10,15,20-Tetrakis(4-aminophenyl)porphyrin
- 5,10,15,20-Tetrakis(p-aminophenyl)porphyrin
- Benzenamine, 4,4′,4′′,4′′′-(21H,23H-porphine-5,10,15,20-tetrayl)tetrakis-
- Porphine, 5,10,15,20-tetrakis(p-aminophenyl)-
- T 1494
- See more synonyms
- Tetra(p-aminophenyl)porphyrin
- Tetrakis(p-aminophenyl)porphyrin
- meso-Tetra(4-aminophenyl)porphyrin
- meso-Tetra(p-aminophenyl)porphine
- meso-Tetrakis(4-aminophenyl)porphyrin
- meso-Tetrakis(p-aminophenyl)porphine
- α,β,γ,δ-Tetrakis(4-aminophenyl)porphine
