CAS 22112-89-6: (5Z,10Z,14Z,19Z)-5,15-diphenyl-21,23-dihydroporphyrin
Description:(5Z,10Z,14Z,19Z)-5,15-diphenyl-21,23-dihydroporphyrin is a synthetic porphyrin derivative characterized by its complex cyclic structure, which includes multiple conjugated double bonds that contribute to its unique optical and electronic properties. This compound features two phenyl groups attached to the porphyrin core, enhancing its stability and solubility in organic solvents. The presence of multiple Z-configured double bonds indicates a specific geometric arrangement, which can influence its reactivity and interaction with light, making it of interest in photochemical applications. Porphyrins, in general, are known for their ability to coordinate with metal ions, which can lead to a variety of applications in catalysis, sensors, and as models for biological systems. The compound's CAS number, 22112-89-6, allows for easy identification in chemical databases. Its unique structural features and properties make it a subject of interest in both organic chemistry and materials science, particularly in the development of organic semiconductors and photodynamic therapy agents.
Formula:C32H22N4
InChI:InChI=1/C32H22N4/c1-3-7-21(8-4-1)31-27-15-11-23(33-27)19-25-13-17-29(35-25)32(22-9-5-2-6-10-22)30-18-14-26(36-30)20-24-12-16-28(31)34-24/h1-20,33,36H/b23-19-,24-20-,25-19-,26-20-,31-27-,31-28-,32-29-,32-30-
- Synonyms:
- 21H,23H-porphine, 5,15-diphenyl-
- 5,15-Diphenylporphine
- 5,15-Diphenylporphyrin