CAS 221148-46-5

2-(4-Ethoxyphenyl)-3-[4-(methylsulfonyl)phenyl]pyrazolo[1,5-b]pyridazine

Description:

2-(4-Ethoxyphenyl)-3-[4-(methylsulfonyl)phenyl]pyrazolo[1,5-b]pyridazine is a chemical compound characterized by its complex structure, which includes a pyrazolo[1,5-b]pyridazine core. This compound features an ethoxy group attached to a phenyl ring and a methylsulfonyl group on another phenyl ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the methylsulfonyl group suggests potential polar characteristics, which can influence its reactivity and interactions with biological systems. This compound may be of interest in medicinal chemistry due to its structural motifs that could interact with biological targets. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be studied for its potential pharmacological activities. As with many organic compounds, safety data should be consulted before handling, as it may pose health risks or environmental hazards.

Formula: C₂₁H₁₉N₃O₃S

InChI: InChI=1S/C21H19N3O3S/c1-3-27-17-10-6-16(7-11-17)21-20(19-5-4-14-22-24(19)23-21)15-8-12-18(13-9-15)28(2,25)26/h4-14H,3H2,1-2H3

InChI key: InChIKey=NXMZBNYLCVTRGB-UHFFFAOYSA-N

SMILES: S(C)(=O)(=O)C1=CC=C(C=2C(=NN3C2C=CC=N3)C4=CC=C(OCC)C=C4)C=C1

Synonyms:

• 2-(4-Ethoxyphenyl)-3-[4-(methylsulfonyl)phenyl]pyrazolo[1,5-b]pyridazine
• Gw 406381
• Pyrazolo[1,5-b]pyridazine, 2-(4-ethoxyphenyl)-3-[4-(methylsulfonyl)phenyl]-

GSK376501A

CAS: 221148-46-5

GSK376501A

Purity: ≥98%

Molecular weight: 531.64g/mol

Ref: 54-BUP20523

GW-406381

CAS: 221148-46-5

GW-406381 is a potent and selective agonist for the peroxisome proliferator-activated receptor delta (PPARδ), which is commonly employed in pharmacological research. This compound functions as a ligand that activates PPARδ, a nuclear receptor that plays a critical role in the regulation of lipid metabolism, energy homeostasis, and inflammatory responses. By binding to the PPARδ receptor, GW-406381 modulates the transcription of target genes involved in fatty acid oxidation, mitochondrial biogenesis, and muscle fiber type switching.

Formula: C₂₁H₁₉N₃O₃S

Purity: Min. 95%

Molecular weight: 393.46 g/mol

Ref: 3D-WIA14846

GW-406381

CAS: 221148-46-5

GW-406381 is a highly selective COX-2 inhibitor peripherally and centrally, reducing spontaneous ectopic discharges following chronic compressive injury.

Formula: C₂₁H₁₉N₃O₃S

Purity: 99.54%

Color and Shape: Solid

Molecular weight: 393.46

Ref: TM-T15449