CAS 221150-19-2

2H,6H-Benzo[1,2-b:5,4-b']dipyran-6-one,5-hydroxy-2-(hydroxymethyl)-7-(4-hydroxyphenyl)-2-methyl-, (-)-

Description:

2H,6H-Benzo[1,2-b:5,4-b']dipyran-6-one, 5-hydroxy-2-(hydroxymethyl)-7-(4-hydroxyphenyl)-2-methyl-, (-)-, with CAS number 221150-19-2, is a complex organic compound characterized by its polycyclic structure, which includes a benzo-dipyran framework. This compound features multiple functional groups, including hydroxyl (-OH) groups, which contribute to its potential biological activity and solubility properties. The presence of the hydroxymethyl group and the 4-hydroxyphenyl moiety suggests that it may exhibit antioxidant properties and could interact with various biological targets. Its stereochemistry, indicated by the (-) notation, implies that it exists as a specific enantiomer, which can influence its reactivity and biological interactions. The compound may be of interest in medicinal chemistry and natural product research due to its structural complexity and potential pharmacological applications. Further studies would be necessary to elucidate its specific properties, mechanisms of action, and potential uses in various fields, including pharmaceuticals and agrochemicals.

Formula: C₂₀H₁₆O₆

InChI: InChI=1S/C20H16O6/c1-20(10-21)7-6-13-15(26-20)8-16-17(18(13)23)19(24)14(9-25-16)11-2-4-12(22)5-3-11/h2-9,21-23H,10H2,1H3

InChI key: InChIKey=OVLQTBOVUNAVGU-UHFFFAOYSA-N

SMILES: OC1=C2C(=CC3=C1C=CC(CO)(C)O3)OC=C(C2=O)C4=CC=C(O)C=C4

Synonyms:

• (-)-5-Hydroxy-2-(hydroxymethyl)-7-(4-hydroxyphenyl)-2-methyl-2H,6H-benzo[1,2-b:5,4-b′]dipyran-6-one
• Erysubin B
• 2H,6H-Benzo[1,2-b:5,4-b′]dipyran-6-one, 5-hydroxy-2-(hydroxymethyl)-7-(4-hydroxyphenyl)-2-methyl-, (-)-
• 5-hydroxy-2-(hydroxymethyl)-7-(4-hydroxyphenyl)-2-methylpyrano[3,2-g]chromen-6-one

Erysubin B

CAS: 221150-19-2

Formula: C₂₀H₁₆O₆

Purity: 99.0%

Molecular weight: 352.3374

Ref: IN-DA00C4RT

Erysubin B

CAS: 221150-19-2

Erysubin B is a natural product from Erythrina caffra Thunb.

Formula: C₂₀H₁₆O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 352.34

Ref: TM-TN3993

Erysubin B

CAS: 221150-19-2

Formula: C₂₀H₁₆O₆

Purity: 95%~99%

Color and Shape: Yellow powder

Molecular weight: 352.342

Ref: BP-SBP00968

Erysubin B

CAS: 221150-19-2

Erysubin B is a synthetic derivative of erythromycin, which is derived from the bacterium *Saccharopolyspora erythraea*. This compound acts primarily through the inhibition of protein synthesis by binding to the 50S ribosomal subunit, thereby preventing the translocation of peptides during translation. Erysubin B is being studied for its potential antibacterial properties, though its full spectrum of activity and efficacy are yet to be completely elucidated.

Formula: C₂₀H₁₆O₆

Purity: Min. 95%

Molecular weight: 352.3 g/mol

Ref: 3D-WIA15019