CymitQuimica logo

CAS 221158-95-8

:

(1R,2S)-2-Aminocyclobutanecarboxylic acid

Description:
(1R,2S)-2-Aminocyclobutanecarboxylic acid, with the CAS number 221158-95-8, is a cyclic amino acid characterized by its unique four-membered ring structure. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH) attached to the cyclobutane ring, which contributes to its potential biological activity. The stereochemistry indicated by (1R,2S) specifies the spatial arrangement of the substituents around the chiral centers, influencing its interactions with biological systems. This compound is of interest in medicinal chemistry and research due to its structural similarity to natural amino acids, which may allow it to participate in protein synthesis or act as a neurotransmitter. Its properties, such as solubility and reactivity, are influenced by the presence of the amino and carboxylic acid functional groups, making it a versatile building block in organic synthesis and pharmaceutical development. Additionally, the unique ring structure may impart distinct conformational characteristics that affect its biological function and interactions.
Formula:C5H9NO2
InChI:InChI=1S/C5H9NO2/c6-4-2-1-3(4)5(7)8/h3-4H,1-2,6H2,(H,7,8)/t3-,4+/m1/s1
InChI key:InChIKey=NSQMWZLLTGEDQU-DMTCNVIQSA-N
SMILES:C(O)(=O)[C@H]1[C@@H](N)CC1
Found 0 products.