CAS 22116-33-2

2-(4-fluorobenzylamino)-ethanol

Description:

2-(4-Fluorobenzylamino)-ethanol, identified by its CAS number 22116-33-2, is an organic compound characterized by the presence of both an amino group and a hydroxyl group, making it an amino alcohol. The structure features a fluorobenzyl group, which contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in water and various organic solvents, which enhances its utility in chemical synthesis and pharmaceutical applications. The presence of the fluorine atom can influence the compound's reactivity and biological activity, potentially affecting its interactions in biological systems. As an amino alcohol, it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, it may serve as a building block in the synthesis of more complex molecules, particularly in medicinal chemistry, where modifications to the amino and hydroxyl groups can lead to the development of new therapeutic agents.

Formula: C₉H₁₂FNO

InChI: InChI=1/C9H12FNO/c10-9-3-1-8(2-4-9)7-11-5-6-12/h1-4,11-12H,5-7H2

SMILES: c1cc(ccc1CNCCO)F

Synonyms:

• 2-[(4-Fluorobenzyl)amino]ethanol
• Ethanol, 2-[[(4-Fluorophenyl)Methyl]Amino]-

2-(4-Fluorobenzylamino)ethanol

CAS: 22116-33-2

Formula: C₉H₁₂FNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 169.1961

Ref: IN-DA00BCB5

2-[(4-Fluorobenzyl)amino]ethanol

CAS: 22116-33-2

2-[(4-Fluorobenzyl)amino]ethanol

Purity: ≥95%

Molecular weight: 169.20g/mol

Ref: 54-PC430520

2-[(4-Fluorobenzyl)amino]ethanol (>90%)

Controlled Product

CAS: 22116-33-2

Applications 2-[(4-fluorobenzyl)amino]ethanol (cas# 22116-33-2) is a useful research chemical.

Formula: C₉H₁₂FNO

Purity: >90%

Color and Shape: Neat

Molecular weight: 169.196

Ref: TR-B434993

2-((4-Fluorobenzyl)amino)ethanol

CAS: 22116-33-2

Formula: C₉H₁₂FNO

Purity: 95%

Molecular weight: 169.199

Ref: 10-F209506