CAS 221177-68-0
:7-(Phenylmethoxy)-1,3-benzodioxole-5-carboxaldehyde
Description:
7-(Phenylmethoxy)-1,3-benzodioxole-5-carboxaldehyde, identified by its CAS number 221177-68-0, is an organic compound characterized by its complex structure, which includes a benzodioxole core and an aldehyde functional group. This compound features a phenylmethoxy substituent, contributing to its unique chemical properties. Typically, compounds of this nature exhibit moderate to high lipophilicity due to the presence of aromatic rings, which can influence their solubility in organic solvents. The aldehyde group is reactive, making it susceptible to oxidation and condensation reactions. Additionally, the presence of the benzodioxole moiety may impart specific biological activities, as many derivatives of benzodioxole are known for their pharmacological properties. The compound's potential applications could span various fields, including medicinal chemistry and materials science, although specific uses would depend on further research into its reactivity and biological interactions. Overall, 7-(Phenylmethoxy)-1,3-benzodioxole-5-carboxaldehyde represents a structurally interesting compound with potential significance in chemical and pharmaceutical research.
Formula:C15H12O4
InChI:InChI=1S/C15H12O4/c16-8-12-6-13(15-14(7-12)18-10-19-15)17-9-11-4-2-1-3-5-11/h1-8H,9-10H2
InChI key:InChIKey=LYLYGYMIOMGBDL-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2=C3C(=CC(C=O)=C2)OCO3
Synonyms:- 3-Benzyloxy-4,5-methylenedioxybenzoaldehyde
- 1,3-Benzodioxole-5-carboxaldehyde, 7-(phenylmethoxy)-
- 7-(Phenylmethoxy)-1,3-benzodioxole-5-carboxaldehyde
- 7-Benzyloxybenzo[d][1,3]dioxole-5-carboxaldehyde
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery