
CAS 2212-99-9
:(3S,3aR,5aS,8aS,8bS)-5a,7,8,8a-Tetrahydro-3-hydroxy-7,7-dimethyl-1-oxo-3H,6H-3a,8b-methano-1H-indeno[4,5-c]furan-4-carboxaldehyde
Description:
The chemical substance with the name "(3S,3aR,5aS,8aS,8bS)-5a,7,8,8a-Tetrahydro-3-hydroxy-7,7-dimethyl-1-oxo-3H,6H-3a,8b-methano-1H-indeno[4,5-c]furan-4-carboxaldehyde" and CAS number 2212-99-9 is a complex organic compound characterized by its unique stereochemistry and functional groups. It features a tetrahydrofuran ring structure, which contributes to its cyclic nature, and includes multiple chiral centers, indicating that it can exist in different stereoisomeric forms. The presence of a hydroxyl group (-OH) and an aldehyde group (-CHO) suggests that it may exhibit reactivity typical of alcohols and aldehydes, potentially participating in various chemical reactions such as oxidation or condensation. Additionally, the compound's structure indicates it may have biological activity, which could be of interest in medicinal chemistry or natural product synthesis. Its specific properties, such as solubility, melting point, and spectral characteristics, would depend on its molecular interactions and the environment in which it is studied.
Formula:C15H18O4
InChI:InChI=1S/C15H18O4/c1-13(2)4-8-3-9(6-16)14-7-15(14,10(8)5-13)12(18)19-11(14)17/h3,6,8,10-11,17H,4-5,7H2,1-2H3/t8-,10+,11+,14+,15-/m1/s1
InChI key:InChIKey=BIUVCPLWWOLECJ-WMABBAGQSA-N
SMILES:O=C1[C@@]23[C@@](C2)(C(C=O)=C[C@]4([C@@]3(CC(C)(C)C4)[H])[H])[C@@H](O)O1
Synonyms:- (3S,3aR,5aS,8aS,8bS)-5a,7,8,8a-Tetrahydro-3-hydroxy-7,7-dimethyl-1-oxo-3H,6H-3a,8b-methano-1H-indeno[4,5-c]furan-4-carboxaldehyde
- 3H,6H-3a,8b-Methano-1H-indeno[4,5-c]furan-4-carboxaldehyde, 5a,7,8,8a-tetrahydro-3-hydroxy-7,7-dimethyl-1-oxo-, [3S-(3α,3aβ,5aβ,8aβ,8bβ)]-
- NSC 318506
- 3H,6H-3a,8b-Methano-1H-indeno[4,5-c]furan-4-carboxaldehyde, 5a,7,8,8a-tetrahydro-3-hydroxy-7,7-dimethyl-1-oxo-, (3S,3aR,5aS,8aS,8bS)-
- Marasmic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Marasmic acid
CAS:Marasmic acid is a bioactive antifungal.Formula:C15H18O4Color and Shape:SolidMolecular weight:262.3
