CAS 221202-36-4
:2,3-difluoro-6-hydroxybenzonitrile
Description:
2,3-Difluoro-6-hydroxybenzonitrile is an organic compound characterized by the presence of both fluorine and hydroxyl functional groups attached to a benzene ring, along with a nitrile group. The molecular structure features two fluorine atoms located at the 2 and 3 positions of the benzene ring, which can influence the compound's reactivity and polarity. The hydroxyl group at the 6 position contributes to its potential as a hydrogen bond donor, enhancing solubility in polar solvents. The nitrile group, which is a carbon triple-bonded to nitrogen, imparts additional chemical properties, including potential reactivity in nucleophilic addition reactions. This compound may exhibit interesting biological activity due to its unique functional groups, making it a subject of interest in medicinal chemistry and material science. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific interactions of these functional groups. Overall, 2,3-difluoro-6-hydroxybenzonitrile represents a versatile structure with potential applications in various chemical and pharmaceutical contexts.
Formula:C7H3F2NO
InChI:InChI=1/C7H3F2NO/c8-5-1-2-6(11)4(3-10)7(5)9/h1-2,11H
SMILES:c1cc(c(C#N)c(c1F)F)O
Synonyms:- Benzonitrile, 2,3-difluoro-6-hydroxy-
- 2,3-Difluoro-6-hydroxybenzonitrile
- 2,3-Difluoro-6-hydroxy-benzonitrile
- Benzonitrile, 2,3-difluoro-6-hydroxy- (9CI)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.