CAS 22122-96-9

(3a'R)-2',3a',4',5',6',7'-hexahydrospiro[cyclohexane-1,3'-indazole]

Description:

(3a'R)-2',3a',4',5',6',7'-hexahydrospiro[cyclohexane-1,3'-indazole] is a chemical compound characterized by its unique spirocyclic structure, which consists of a cyclohexane ring fused to an indazole moiety. This compound features a hexahydro framework, indicating the presence of multiple saturated carbon atoms, contributing to its stability and potential hydrophobic properties. The stereochemistry denoted by (3a'R) suggests specific spatial arrangements of atoms, which can influence the compound's reactivity and interactions with biological systems. The presence of nitrogen in the indazole structure may impart basic properties, allowing for potential interactions with various receptors or enzymes. Additionally, the compound's molecular weight and specific functional groups can affect its solubility, melting point, and boiling point, which are critical for applications in pharmaceuticals or materials science. Overall, the unique structural features of this compound may lead to interesting biological activities or applications in medicinal chemistry, although specific biological data would require further investigation.

Formula: C₁₂H₂₀N₂

InChI: InChI=1/C12H20N2/c1-4-8-12(9-5-1)10-6-2-3-7-11(10)13-14-12/h10,14H,1-9H2/t10-/m0/s1

SMILES: C1CCC2(CC1)[C@H]1CCCCC1=NN2

2',3'A,4',5',6',7'-Hexahydrospiro[cyclohexane-1,3'-indazole]

CAS: 22122-96-9

Versatile small molecule scaffold

Formula: C₁₂H₂₀N₂

Purity: Min. 95%

Molecular weight: 192.3 g/mol

Ref: 3D-XAA12296