CAS 221225-04-3
:2-[(E)-2-(2-methylphenyl)ethenyl]-4,5-dihydro-1H-imidazole ethanedioate (1:1)
Description:
2-[(E)-2-(2-methylphenyl)ethenyl]-4,5-dihydro-1H-imidazole ethanedioate (1:1), with CAS number 221225-04-3, is a chemical compound characterized by its imidazole core structure, which is a five-membered ring containing two nitrogen atoms. This compound features a substituted ethenyl group, specifically with a 2-methylphenyl moiety, indicating the presence of a phenyl ring with a methyl group in the ortho position. The ethanedioate part suggests the presence of an oxalic acid derivative, contributing to its potential acidity and reactivity. The (E) configuration denotes the specific geometric arrangement of the ethenyl double bond, which can influence the compound's physical and chemical properties, such as solubility and reactivity. This compound may exhibit interesting biological activities or applications in organic synthesis, although specific data on its reactivity, stability, and potential uses would require further investigation. Overall, its unique structure positions it as a potentially valuable compound in various chemical contexts.
Formula:C14H16N2O4
InChI:InChI=1/C12H14N2.C2H2O4/c1-10-4-2-3-5-11(10)6-7-12-13-8-9-14-12;3-1(4)2(5)6/h2-7H,8-9H2,1H3,(H,13,14);(H,3,4)(H,5,6)/b7-6+;
Synonyms:- 1H-imidazole, 4,5-dihydro-2-[(E)-2-(2-methylphenyl)ethenyl]-, ethanedioate (1:1)
- 2-[(E)-2-(2-Methylphenyl)vinyl]-4,5-dihydro-1H-imidazole ethanedioate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Metrazoline
CAS:<p>Metrazoline (o-Methyl-tracizoline) acts as a ligand for adrenergic receptors (low affinity) and imidazoline I2 receptors.</p>Formula:C14H16N2O4Color and Shape:SolidMolecular weight:276.288

