CAS 221225-04-3

2-[(E)-2-(2-methylphenyl)ethenyl]-4,5-dihydro-1H-imidazole ethanedioate (1:1)

Description:

2-[(E)-2-(2-methylphenyl)ethenyl]-4,5-dihydro-1H-imidazole ethanedioate (1:1), with CAS number 221225-04-3, is a chemical compound characterized by its imidazole core structure, which is a five-membered ring containing two nitrogen atoms. This compound features a substituted ethenyl group, specifically with a 2-methylphenyl moiety, indicating the presence of a phenyl ring with a methyl group in the ortho position. The ethanedioate part suggests the presence of an oxalic acid derivative, contributing to its potential acidity and reactivity. The (E) configuration denotes the specific geometric arrangement of the ethenyl double bond, which can influence the compound's physical and chemical properties, such as solubility and reactivity. This compound may exhibit interesting biological activities or applications in organic synthesis, although specific data on its reactivity, stability, and potential uses would require further investigation. Overall, its unique structure positions it as a potentially valuable compound in various chemical contexts.

Formula: C₁₄H₁₆N₂O₄

InChI: InChI=1/C12H14N2.C2H2O4/c1-10-4-2-3-5-11(10)6-7-12-13-8-9-14-12;3-1(4)2(5)6/h2-7H,8-9H2,1H3,(H,13,14);(H,3,4)(H,5,6)/b7-6+;

Synonyms:

• 1H-imidazole, 4,5-dihydro-2-[(E)-2-(2-methylphenyl)ethenyl]-, ethanedioate (1:1)
• 2-[(E)-2-(2-Methylphenyl)vinyl]-4,5-dihydro-1H-imidazole ethanedioate (1:1)

Metrazoline

Controlled Product

CAS: 221225-04-3

Formula: C₁₂H₁₄N₂·C₂H₂O₄

Color and Shape: Neat

Molecular weight: 276.28

Ref: TR-M338938

Metrazoline

CAS: 221225-04-3

Metrazoline (o-Methyl-tracizoline) acts as a ligand for adrenergic receptors (low affinity) and imidazoline I2 receptors.

Formula: C₁₄H₁₆N₂O₄

Color and Shape: Solid

Molecular weight: 276.288

Ref: TM-T204804