CAS 22123-19-9
:6-methyl-4-trifluoromethyl-2(1H)-pyridone
Description:
6-Methyl-4-trifluoromethyl-2(1H)-pyridone, identified by its CAS number 22123-19-9, is a heterocyclic organic compound belonging to the pyridone class. This compound features a pyridine ring with a ketone functional group and is characterized by the presence of a methyl group at the 6-position and a trifluoromethyl group at the 4-position. The trifluoromethyl group significantly influences its chemical properties, enhancing its lipophilicity and potentially affecting its reactivity and biological activity. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique structure allows for various applications in pharmaceuticals and agrochemicals, where it may serve as an intermediate or active ingredient. Additionally, the presence of fluorine atoms can impart unique electronic properties, making it of interest in medicinal chemistry for the development of novel therapeutic agents. As with many fluorinated compounds, it is essential to consider its environmental impact and stability during synthesis and application.
Formula:C7H6F3NO
InChI:InChI=1/C7H6F3NO/c1-4-2-5(7(8,9)10)3-6(12)11-4/h2-3H,1H3,(H,11,12)
SMILES:Cc1cc(cc(n1)O)C(F)(F)F
Synonyms:- 6-methyl-4-(trifluoromethyl)pyridin-2(1H)-one
- 6-Methyl-4-(trifluoromethyl)-2(1H)-pyridone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
6-Methyl-4-trifluoromethyl-2(1H)-pyridone, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H6F3NOPurity:97%Color and Shape:Pale yellow, Powder or crystals or crystalline powderMolecular weight:177.136-methyl-4-(trifluoromethyl)-1,2-dihydropyridin-2-one
CAS:Formula:C7H6F3NOPurity:98%Color and Shape:SolidMolecular weight:177.12386-Methyl-4-(trifluoromethyl)pyridin-2(1H)-one
CAS:6-Methyl-4-(trifluoromethyl)pyridin-2(1H)-onePurity:≥95%Color and Shape:PowderMolecular weight:177.12g/mol6-Methyl-4-trifluoromethyl-pyridin-2-ol
CAS:Formula:C7H6F3NOPurity:95%Color and Shape:White powderMolecular weight:177.126



