CAS 221242-71-3

[methoxy(naphthalen-1-yl)methylidene]propanedinitrile

Description:

The chemical substance known as [methoxy(naphthalen-1-yl)methylidene]propanedinitrile, with the CAS number 221242-71-3, is a complex organic compound characterized by its unique structure that includes a methoxy group, a naphthalene moiety, and a propanedinitrile functional group. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for π-π stacking interactions due to the presence of the naphthalene ring. The methoxy group contributes to its solubility in organic solvents and may influence its reactivity and interaction with other chemical species. The presence of the dinitrile functional group suggests potential applications in organic synthesis and materials science, as nitriles can participate in various chemical reactions, including nucleophilic additions and cycloadditions. Additionally, the compound may exhibit interesting optical properties, making it a candidate for studies in photochemistry or as a dye. Overall, its structural features suggest a versatile compound with potential applications in various fields of chemistry.

Formula: C₁₅H₁₀N₂O

InChI: InChI=1/C15H10N2O/c1-18-15(12(9-16)10-17)14-8-4-6-11-5-2-3-7-13(11)14/h2-8H,1H3

SMILES: COC(=C(C#N)C#N)c1cccc2ccccc12

2-[Methoxy(naphthalen-1-yl)methylidene]propanedinitrile

CAS: 221242-71-3

2-[Methoxy(naphthalen-1-yl)methylidene]propanedinitrile

Purity: ≥95%

Molecular weight: 234.25g/mol

Ref: 54-OR303960

1-Naphthyl(methoxy) Propanedinitrile

Controlled Product

CAS: 221242-71-3

Applications Use for tyrosine kinase src inhibitor design.
References Levitzki, A., et al.: Science, 267, 1782 (1995), Smith, G., et al.: J. Biol. Chem., 272, 15804 (1997), Peet, D., et al.: Chem. Biol., 5, 13 (1998),

Formula: C₁₅H₁₀N₂O

Color and Shape: Neat

Molecular weight: 234.25

Ref: TR-N378650