CAS 221243-34-1

5-amino-1-tert-butyl-3-naphthalen-2-yl-1H-pyrazole-4-carbonitrile

Description:

5-amino-1-tert-butyl-3-naphthalen-2-yl-1H-pyrazole-4-carbonitrile is a chemical compound characterized by its complex structure, which includes a pyrazole ring, a naphthalene moiety, and a tert-butyl group. The presence of an amino group and a carbonitrile functional group contributes to its reactivity and potential applications in various fields, including medicinal chemistry and material science. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential for hydrogen bonding and π-π stacking interactions due to the aromatic naphthalene component. The compound may also possess biological activity, making it of interest for pharmaceutical research. Additionally, its CAS number, 221243-34-1, allows for easy identification and reference in chemical databases. Overall, this compound's unique structural features and functional groups make it a subject of interest for further study and application in various chemical contexts.

Formula: C₁₈H₁₈N₄

InChI: InChI=1/C18H18N4/c1-18(2,3)22-17(20)15(11-19)16(21-22)14-9-8-12-6-4-5-7-13(12)10-14/h4-10H,20H2,1-3H3

SMILES: CC(C)(C)n1c(c(C#N)c(c2ccc3ccccc3c2)n1)N

5-Amino-3-(1-naphthyl)-4-cyano-1-tert-butylpyrazole

Controlled Product

CAS: 221243-34-1

Applications 5-Amino-3-(1-naphthyl)-4-cyano-1-tert-butylpyrazole (cas# 221243-34-1) is a compound useful in organic synthesis.
References Bishop, A.C., et al.: J. Am. Chem. Soc., 121, 627 (1999)

Formula: C₁₈H₁₈N₄

Color and Shape: Neat

Molecular weight: 290.36

Ref: TR-A618375