CAS 221243-77-2

5-amino-1-tert-butyl-3-(naphthalen-1-ylmethyl)-1H-pyrazole-4-carbonitrile

Description:

5-amino-1-tert-butyl-3-(naphthalen-1-ylmethyl)-1H-pyrazole-4-carbonitrile is a chemical compound characterized by its complex structure, which includes a pyrazole ring, an amino group, a tert-butyl group, and a naphthylmethyl substituent. The presence of the carbonitrile functional group indicates that it has a cyano group (-C≡N), which contributes to its reactivity and potential applications in organic synthesis. This compound is likely to exhibit moderate to high lipophilicity due to the bulky tert-butyl and naphthyl groups, which can influence its solubility in organic solvents. Additionally, the amino group may participate in hydrogen bonding, affecting its interactions in biological systems. The compound's unique structure suggests potential utility in medicinal chemistry, particularly in the development of pharmaceuticals, as pyrazole derivatives are often explored for their biological activities. Its CAS number, 221243-77-2, allows for easy identification and reference in chemical databases and literature.

Formula: C₁₉H₂₀N₄

InChI: InChI=1/C19H20N4/c1-19(2,3)23-18(21)16(12-20)17(22-23)11-14-9-6-8-13-7-4-5-10-15(13)14/h4-10H,11,21H2,1-3H3

SMILES: CC(C)(C)n1c(c(C#N)c(Cc2cccc3ccccc23)n1)N

5-Amino-1-tert-butyl-3-(1'-naphthylmethyl)-4-cyanopyrazole

Controlled Product

CAS: 221243-77-2

Applications A highly potent (IC50=1.5nM) and uniquely specific tyrosine kinase inhibitor of a rationally engineered v-Src tyrosine kinase.
References Bishop, A.C., et al.: J. Am. Chem. Soc., 121, 627 (1999)

Formula: C₁₉H₂₀N₄

Color and Shape: Neat

Molecular weight: 304.39

Ref: TR-A603002