CAS 221272-62-4
:4'-ethynylthymidine
Description:
4'-Ethynylthymidine is a synthetic nucleoside analog of thymidine, characterized by the presence of an ethynyl group at the 4' position of the thymidine structure. This modification enhances its potential as an antiviral agent, particularly against viruses such as HIV. The compound exhibits properties typical of nucleosides, including the ability to incorporate into nucleic acids, which can interfere with viral replication. Its structure includes a pyrimidine base (thymine) linked to a deoxyribose sugar, with the ethynyl group providing unique reactivity and stability. 4'-Ethynylthymidine is often studied for its role in molecular biology and medicinal chemistry, particularly in the development of antiviral therapies. The compound's mechanism of action involves the inhibition of viral reverse transcriptase, thereby preventing the synthesis of viral DNA from RNA templates. Additionally, its pharmacokinetic properties, such as solubility and bioavailability, are critical for its therapeutic applications. Overall, 4'-ethynylthymidine represents a significant advancement in the design of antiviral agents targeting nucleic acid synthesis.
Formula:C12H14N2O5
InChI:InChI=1/C12H14N2O5/c1-3-12(6-15)8(16)4-9(19-12)14-5-7(2)10(17)13-11(14)18/h1,5,8-9,15-16H,4,6H2,2H3,(H,13,17,18)/t8-,9+,12+/m0/s1
Synonyms:- 4'-.alpha.-Ethynylthymidine
- 4'C-ethynyl-thymidine
- Thymidine, 4'-C-ethynyl-
- 4'-C-Ethynylthymidine
- 4'-Ethynylthymidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4'-C-Ethynylthymidine
CAS:Controlled ProductFormula:C12H14N2O5Color and Shape:NeatMolecular weight:259.1964'-Ethynylthymidine
CAS:<p>4'-Ethynylthymidine is a novel nucleoside analog that has been shown to be active against HIV-1. It has been shown to inhibit the incorporation of uridine into viral DNA and terminate elongation of viral DNA. 4'-Ethynylthymidine has also been shown to be active against other viruses such as vesicular stomatitis virus, influenza virus, and hepatitis C virus. The cytotoxicity of this drug is significant and may provide potential therapeutics for cancer treatment.</p>Purity:Min. 95%

