CAS 221287-88-3
:methyl (3R,4R,5R,6R)-3,4,5-triacetoxy-6-(2-benzyloxycarbonylphenoxy)tetrahydropyran-2-carboxylate
Description:
Methyl (3R,4R,5R,6R)-3,4,5-triacetoxy-6-(2-benzyloxycarbonylphenoxy)tetrahydropyran-2-carboxylate is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features multiple functional groups, including acetoxy groups, which contribute to its reactivity and solubility properties. The presence of the benzyloxycarbonylphenoxy moiety suggests potential applications in medicinal chemistry, particularly in drug design, due to its ability to interact with biological targets. The stereochemistry indicated by the (3R,4R,5R,6R) configuration implies specific spatial arrangements of atoms, which can significantly influence the compound's biological activity and pharmacokinetics. Additionally, the methyl ester functional group enhances its lipophilicity, potentially improving membrane permeability. Overall, this compound's unique structural features and functional groups make it a subject of interest in synthetic organic chemistry and pharmacological research.
Formula:C27H28O12
InChI:InChI=1/C27H28O12/c1-15(28)35-21-22(36-16(2)29)24(37-17(3)30)27(39-23(21)26(32)33-4)38-20-13-9-8-12-19(20)25(31)34-14-18-10-6-5-7-11-18/h5-13,21-24,27H,14H2,1-4H3/t21-,22-,23?,24-,27+/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Methyl 1-((2-Benzyloxycarbonxyl)phenyl)-2,3,4-tri-O-acetyl-β-D- glucopyranuronate-d4
CAS:Controlled Product<p>Applications Methyl 1-((2-Benzyloxycarbonxyl)phenyl)-2,3,4-tri-O-acetyl-β-D-glucopyranuronate-d4 is an intermediate in the synthesis of the metabolites of Nitazoxanide (N490100), an anthelmintic (cestodes), antiprotozoal (cryptosporidium) agent.<br>References Honma, K., et al.: Chem. Pharm. Bull., 24, 394 (1976), Dubreuil, L., et al.: Antimicrob. Agents Chemother., 40, 2266 (1996), Stockis, A., et al.: Int. J. Clin. Pharmacol. Ther., 34, 349 (1996),<br></p>Formula:C27H24D4O12Color and Shape:NeatMolecular weight:548.53Methyl 1-((2-Benzyloxycarbonxyl)phenyl)-2,3,4-tri-O-acetyl-β-D-glucopyranuronate
CAS:Controlled Product<p>Applications An intermediate in the synthesis of the metabolite of Nitazoxanide.<br>References Honma, K., et al.: Chem. Pharm. Bull., 24, 394 (1976),<br></p>Formula:C27H28O12Color and Shape:NeatMolecular weight:544.504
