CAS 2213-23-2
:(±)-2,4-Dimethylheptane
Description:
(±)-2,4-Dimethylheptane is an organic compound classified as an alkane, specifically a branched-chain hydrocarbon. It features a seven-carbon backbone with two methyl groups attached at the second and fourth carbon positions, contributing to its structural isomerism. This compound is a colorless liquid at room temperature and is insoluble in water, but soluble in organic solvents, reflecting typical characteristics of hydrocarbons. Its molecular formula is C9H20, and it has a relatively low boiling point compared to larger alkanes, which is indicative of its volatility. The presence of multiple methyl groups enhances its branching, leading to lower density and higher octane ratings, making it of interest in fuel applications. Additionally, (±)-2,4-Dimethylheptane exhibits a chiral nature due to the presence of stereocenters, resulting in two enantiomers. Its physical and chemical properties, such as viscosity and reactivity, are influenced by its branched structure, which affects its interactions in various chemical processes. Overall, this compound is significant in both industrial applications and research contexts.
Formula:C9H20
InChI:InChI=1S/C9H20/c1-5-6-9(4)7-8(2)3/h8-9H,5-7H2,1-4H3
InChI key:InChIKey=AUKVIBNBLXQNIZ-UHFFFAOYSA-N
SMILES:C(C(CCC)C)C(C)C
Synonyms:- 2,4-Dimethylheptane
- Heptane, 2,4-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.


