CymitQuimica logo

CAS 22133-40-0

:

4-(propylsulfanyl)aniline

Description:
4-(Propylsulfanyl)aniline, also known by its CAS number 22133-40-0, is an organic compound that features both an aniline and a propylsulfanyl group. This compound is characterized by its aromatic amine structure, where the aniline moiety consists of a benzene ring bonded to an amino group (-NH2). The propylsulfanyl group (-S-C3H7) is attached to the para position of the aniline ring, which influences the compound's chemical reactivity and physical properties. Typically, compounds of this nature exhibit moderate solubility in organic solvents and may have limited solubility in water due to the hydrophobic nature of the propyl group. The presence of the sulfanyl group can impart unique reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical applications. Safety data should be consulted for handling and potential toxicity, as with all chemical substances.
Formula:C9H13NS
InChI:InChI=1/C9H13NS/c1-2-7-11-9-5-3-8(10)4-6-9/h3-6H,2,7,10H2,1H3
SMILES:CCCSc1ccc(cc1)N
Synonyms:
  • Benzenamine, 4-(Propylthio)-
Found 0 products.