CAS 22134-75-4
:4-Amino-3,5-dichlorobenzenesulfonamide
Description:
4-Amino-3,5-dichlorobenzenesulfonamide, with the CAS number 22134-75-4, is an organic compound characterized by the presence of an amino group and a sulfonamide functional group attached to a dichlorobenzene ring. This compound typically appears as a solid and is soluble in polar solvents due to the sulfonamide group, which enhances its hydrophilicity. The presence of chlorine atoms on the benzene ring contributes to its reactivity and potential applications in various chemical reactions. It is often utilized in the synthesis of pharmaceuticals and agrochemicals, particularly as an intermediate in the production of sulfonamide antibiotics. The compound exhibits properties such as antibacterial activity, making it significant in medicinal chemistry. Additionally, its structural features allow for potential modifications that can lead to derivatives with enhanced biological activity or altered solubility profiles. Safety data should be consulted for handling and usage, as with all chemical substances, to ensure proper precautions are taken.
Formula:C6H6Cl2N2O2S
InChI:InChI=1S/C6H6Cl2N2O2S/c7-4-1-3(13(10,11)12)2-5(8)6(4)9/h1-2H,9H2,(H2,10,11,12)
InChI key:InChIKey=DVZMRTJKNJKEGV-UHFFFAOYSA-N
SMILES:S(N)(=O)(=O)C1=CC(Cl)=C(N)C(Cl)=C1
Synonyms:- 3,5-Dichlorosulfanilamide
- 3,5-Dichlorosulfanilimide
- 4-Amino-3,5-Dichlorobenzenesulfonamide
- Benzenesulfonamide, 4-amino-3,5-dichloro-
- Nsc 62888
- Sulfanilamide, 3,5-dichloro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3,5-Dichlorosulfanilamide
CAS:Formula:C6H6Cl2N2O2SPurity:>98.0%(N)Color and Shape:Light yellow to Brown powder to crystalMolecular weight:241.094-Amino-3,5-dichlorobenzenesulfonamide
CAS:Formula:C6H6Cl2N2O2SPurity:95%Color and Shape:SolidMolecular weight:241.09504-Amino-3,5-Dichlorobenzenesulfonamide
CAS:4-Amino-3,5-DichlorobenzenesulfonamidePurity:99%Molecular weight:241.1g/mol4-Amino-3,5-dichlorobenzenesulfonamide
CAS:Formula:C6H6Cl2N2O2SPurity:≥98%Color and Shape:Solid, Pale yellow to yellow red powderMolecular weight:241.093,5-Dichlorosulfanilamide
CAS:3,5-Dichlorosulfanilamide is a potent inhibitor of hydrogen peroxide anhydrase. It has been shown to outperform other sulfonamides in the inhibition of anhydrase activity. 3,5-Dichlorosulfanilamide inhibits the enzyme by forming a covalent adduct with the sulfonamide group and carbonic acid. This covalent adduct prevents the enzyme from binding to its substrate, thereby preventing catalysis. 3,5-Dichlorosulfanilamide also shows stereoselective inhibition of anhydrase enzymes. The synthesis of this drug can be efficiently achieved using a synthetic route that features high yields and short reaction times.Formula:C6H6Cl2N2O2SPurity:Min. 95%Molecular weight:241.09 g/mol




