CAS 221342-48-9

spiro[3.5]nonane-6,8-dione

Description:

Spiro[3.5]nonane-6,8-dione is a bicyclic organic compound characterized by its unique spiro structure, which consists of two fused rings sharing a single carbon atom. This compound features two ketone functional groups located at the 6 and 8 positions of the nonane framework, contributing to its reactivity and potential applications in organic synthesis. The presence of these carbonyl groups typically enhances the compound's electrophilic character, making it useful in various chemical reactions, such as nucleophilic additions. The spiro configuration can also influence the compound's stereochemistry, leading to distinct isomeric forms. In terms of physical properties, spiro[3.5]nonane-6,8-dione is likely to be a solid at room temperature, with solubility in organic solvents. Its unique structure and functional groups may lend it potential applications in medicinal chemistry, materials science, or as an intermediate in the synthesis of more complex molecules. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.

Formula: C₉H₁₂O₂

InChI: InChI=1/C9H12O2/c10-7-4-8(11)6-9(5-7)2-1-3-9/h1-6H2

SMILES: C1CC2(C1)CC(=O)CC(=O)C2

Spiro[3.5]nonane-6,8-dione

CAS: 221342-48-9

Formula: C₉H₁₂O₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 152.1904

Ref: IN-DA00BG3Y

Spiro[3.5]nonane-6,8-dione

CAS: 221342-48-9

Spiro[3.5]nonane-6,8-dione

Purity: 96%

Molecular weight: 152.19g/mol

Ref: 54-OR81486

Spiro[3.5]nonane-6,8-dione

CAS: 221342-48-9

Formula: C₉H₁₂O₂

Purity: 96%

Molecular weight: 152.193

Ref: 10-F227399

Spiro[3.5]nonane-6,8-dione

CAS: 221342-48-9

Spiro[3.5]nonane-6,8-dione is a synthetic target molecule that belongs to the class of organic compounds called epoxides. This molecule can be synthesized by a process that begins with the addition of acetonedicarboxylate to an epoxide followed by the addition of hydrogen peroxide. The resulting product is an epoxide and hydrogen peroxide mixture, which can be converted into spiro[3.5]nonane-6,8-dione in a second step with an acrylate or peroxide. Spiro[3.5]nonane-6,8-dione has been used as a research intermediate in the synthesis of other molecules.

Formula: C₉H₁₂O₂

Purity: Min. 95%

Molecular weight: 152.19 g/mol

Ref: 3D-WIA34248