CAS 22135-59-7

N-chloro-2-[o-tolyl(phenyl)methoxy]ethanamine

Description:

N-chloro-2-[o-tolyl(phenyl)methoxy]ethanamine, with the CAS number 22135-59-7, is a chemical compound characterized by its unique structure, which includes a chloro group, an ethanamine backbone, and an ether linkage to an o-tolyl(phenyl)methoxy group. This compound typically exhibits properties associated with both amines and ethers, such as potential solubility in organic solvents and reactivity due to the presence of the chloro substituent. The presence of aromatic rings in its structure may contribute to its stability and influence its interactions with other chemical species. Additionally, the chloro group can enhance its reactivity in nucleophilic substitution reactions. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the overall molecular weight. Safety and handling precautions are essential, as compounds containing halogens can pose health risks. Always refer to safety data sheets and conduct thorough risk assessments when working with such substances.

Formula: C₁₆H₁₇ClO

InChI: InChI=1/C16H18ClNO/c1-13-7-5-6-10-15(13)16(19-12-11-18-17)14-8-3-2-4-9-14/h2-10,16,18H,11-12H2,1H3

SMILES: Cc1ccccc1C(c1ccccc1)OCCNCl

Synonyms:

• 1-[(2-Chloroethoxy)phenylmethyl]-2-methylbenzene
• 2-Chloroethyl o-Methyl-a-phenylbenzyl Ether
• 2-Chloroethyl o-Methyl-α-phenylbenzyl Ether
• 2-Chloro(methylphenyl)phenylmethoxy Ethane Ether

2-Chloro(methylphenyl)phenylmethoxy Ethane Ether

CAS: 22135-59-7

Formula: C₁₆H₁₇ClO

Molecular weight: 260.76

Ref: ST-EA-CP-D23016