CymitQuimica logo

CAS 22138-73-4

:

4-Fluoro-alpha-methyl-benzenepropanic acid

Description:
4-Fluoro-alpha-methyl-benzenepropanic acid, also known by its CAS number 22138-73-4, is an aromatic carboxylic acid characterized by the presence of a fluorine atom and a methyl group on the benzene ring. This compound features a propanoic acid functional group, which contributes to its acidic properties. The fluorine substitution can influence the compound's reactivity, polarity, and biological activity, making it of interest in various chemical and pharmaceutical applications. Typically, compounds like this may exhibit moderate solubility in polar solvents due to the carboxylic acid group, while the aromatic ring can provide stability and hydrophobic characteristics. The presence of the fluorine atom can enhance the compound's lipophilicity and may affect its interaction with biological systems. As with many organic acids, it may participate in acid-base reactions and can serve as a precursor or intermediate in synthetic organic chemistry. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C10H11FO2
InChI:InChI=1S/C10H11FO2/c1-7(10(12)13)6-8-2-4-9(11)5-3-8/h2-5,7H,6H2,1H3,(H,12,13)
InChI key:KPWBMCKJLTZFFT-UHFFFAOYSA-N
SMILES:CC(CC1=CC=C(C=C1)F)C(=O)O
Synonyms:
  • p-Fluoro-alpha-methylhydrocinnamic acid
Found 6 products.