CAS 2214-03-1

1,4,5,6-tetrahydrocyclopenta[c]pyrazole

Description:

1,4,5,6-Tetrahydrocyclopenta[c]pyrazole is a heterocyclic organic compound characterized by its bicyclic structure, which includes a pyrazole ring fused to a cyclopentane ring. This compound typically exhibits a molecular formula that reflects its cyclic nature and the presence of nitrogen atoms within the pyrazole moiety. It is a colorless to pale yellow solid at room temperature and is soluble in various organic solvents. The compound is of interest in medicinal chemistry and materials science due to its potential biological activities and applications in the development of pharmaceuticals. Its structure allows for various functionalization, which can enhance its reactivity and interaction with biological targets. Additionally, 1,4,5,6-tetrahydrocyclopenta[c]pyrazole may exhibit properties such as moderate stability under standard conditions and the ability to participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Overall, this compound represents a unique scaffold for further exploration in chemical research and development.

Formula: C₆H₈N₂

InChI: InChI=1/C6H8N2/c1-2-5-4-7-8-6(5)3-1/h4H,1-3H2,(H,7,8)

SMILES: C1Cc2c[nH]nc2C1

Synonyms:

• Cyclopenta[C]Pyrazole, 1,4,5,6-Tetrahydro-

1,4,5,6-Tetrahydrocyclopenta[c]pyrazole HCl

CAS: 2214-03-1

Formula: C₆H₈N₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 108.1411

Ref: IN-DA003DLL

1,4,5,6-Tetrahydrocyclopenta[c]pyrazole

CAS: 2214-03-1

1,4,5,6-Tetrahydrocyclopenta[c]pyrazole

Formula: C₆H₈N₂

Purity: 96%

Color and Shape: yellow solid

Molecular weight: 108.14g/mol

Ref: 54-OR909697

1,4,5,6-tetrahydrocyclopenta[c]pyrazole

CAS: 2214-03-1

Formula: C₆H₈N₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 108.144

Ref: 10-F311703