CAS 22148-20-5
:1-(4-bromophenyl)piperidine
Description:
1-(4-Bromophenyl)piperidine is an organic compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a bromophenyl group at the 1-position of the piperidine ring significantly influences its chemical properties and reactivity. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its moderate solubility in organic solvents, such as ethanol and dichloromethane, while being less soluble in water due to its hydrophobic aromatic bromine substituent. The bromine atom introduces both steric and electronic effects, which can affect the compound's reactivity in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, 1-(4-bromophenyl)piperidine may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Safety precautions should be taken when handling this compound, as it may pose health risks, including potential toxicity and environmental hazards.
Formula:C11H14BrN
InChI:InChI=1/C11H14BrN/c12-10-4-6-11(7-5-10)13-8-2-1-3-9-13/h4-7H,1-3,8-9H2
SMILES:C1CCN(CC1)c1ccc(cc1)Br
Synonyms:- Piperidine, 1-(4-Bromophenyl)-
- N-(4-Bromophenyl)piperidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-(4-Bromophenyl)piperidine
CAS:Formula:C11H14BrNPurity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:240.141-(4-Bromophenyl)piperidine, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C11H14BrNPurity:97%Molecular weight:240.141-(4-Bromophenyl)piperidine
CAS:Formula:C11H14BrNPurity:98%Color and Shape:SolidMolecular weight:240.13961-(4-Bromophenyl)piperidine
CAS:1-(4-Bromophenyl)piperidinePurity:98%Color and Shape:Off-White PowderMolecular weight:240.14g/mol1-(4-Bromophenyl)piperidine
CAS:Formula:C11H14BrNPurity:95%Color and Shape:SolidMolecular weight:240.144




