CAS 22149-35-5: Kaempferol 3-O-gentiobioside
Description:Kaempferol 3-O-gentiobioside is a flavonoid glycoside, a type of plant secondary metabolite known for its potential health benefits. It is derived from kaempferol, a flavonoid that exhibits antioxidant, anti-inflammatory, and anticancer properties. The "3-O-gentiobioside" part of its name indicates that a gentiobiose sugar moiety is attached to the kaempferol at the 3-position, which can influence its solubility and bioactivity. This compound is typically found in various plants, particularly in certain herbs and vegetables, contributing to their nutritional and medicinal value. Kaempferol 3-O-gentiobioside may exhibit various biological activities, including the modulation of cellular signaling pathways and the enhancement of immune responses. Its structural characteristics, including the presence of hydroxyl groups, contribute to its reactivity and interaction with other biological molecules. Research into this compound continues to explore its potential therapeutic applications and mechanisms of action in human health.
Formula:C27H30O16
InChI:InChI=1S/C27H30O16/c28-7-14-17(32)20(35)22(37)26(41-14)39-8-15-18(33)21(36)23(38)27(42-15)43-25-19(34)16-12(31)5-11(30)6-13(16)40-24(25)9-1-3-10(29)4-2-9/h1-6,14-15,17-18,20-23,26-33,35-38H,7-8H2/t14-,15-,17-,18-,20+,21+,22-,23-,26-,27+/m1/s1
InChI key:InChIKey=BITPRCODIALMOV-DEFKTLOSSA-N
SMILES:O=C1C(OC2OC(COC3OC(CO)C(O)C(O)C3O)C(O)C(O)C2O)=C(OC=4C=C(O)C=C(O)C14)C=5C=CC(O)=CC5
- Synonyms:
- 3-[(6-O-β-D-Glucopyranosyl-β-D-glucopyranosyl)oxy]-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 3-[(6-O-β-D-glucopyranosyl-β-D-glucopyranosyl)oxy]-5,7-dihydroxy-2-(4-hydroxyphenyl)-
- Kaempferol 3-gentiobioside
- 3-O-β-D-Glucosyl-(1→6)-β-D-glucosylkaempferol
- Flavone, 3,4′,5,7-tetrahydroxy-, 3-(6-O-β-D-glucopyranosyl-β-D-glucopyranoside)
