CAS 2215-21-6
:3,5-Diisopropylsalicylic acid
Description:
3,5-Diisopropylsalicylic acid is an organic compound characterized by its salicylic acid backbone, which is substituted at the 3 and 5 positions with isopropyl groups. This structure contributes to its unique physical and chemical properties. The compound typically appears as a white to off-white crystalline solid and is relatively insoluble in water, but may dissolve in organic solvents such as ethanol and acetone. It exhibits acidic properties due to the presence of the carboxylic acid functional group, allowing it to participate in various chemical reactions, including esterification and amidation. 3,5-Diisopropylsalicylic acid may also exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure influences its reactivity and potential applications, including use as an intermediate in organic synthesis or as a potential therapeutic agent. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C13H18O3
InChI:InChI=1S/C13H18O3/c1-7(2)9-5-10(8(3)4)12(14)11(6-9)13(15)16/h5-8,14H,1-4H3,(H,15,16)
InChI key:InChIKey=XUFUYOGWFZSHGE-UHFFFAOYSA-N
SMILES:C(C)(C)C1=C(O)C(C(O)=O)=CC(C(C)C)=C1
Synonyms:- 2-Hydroxy-3,5-Bis(1-Methylethyl)Benzoate
- 2-Hydroxy-3,5-Di(Propan-2-Yl)Benzoic Acid
- 2-Hydroxy-3,5-bis(1-methylethyl)benzoic acid
- 2-Hydroxy-3,5-bis(propan-2-yl)benzoic acid
- 2-Hydroxy-3,5-diisopropylbenzoic acid
- 3,5-Diisopropyl-2-hydroxybenzoic acid
- Benzoic acid, 2-hydroxy-3,5-bis(1-methylethyl)-
- Salicylic acid, 3,5-diisopropyl-
- 3,5-Diisopropylsalicylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-Hydroxy-3,5-diisopropylbenzoic acid
CAS:Formula:C13H18O3Purity:97%Color and Shape:SolidMolecular weight:222.28023,5-Bis(isopropyl)-2-hydroxybenzoic acid
CAS:3,5-Bis(isopropyl)-2-hydroxybenzoic acidFormula:C13H18O3Purity:98%Color and Shape: white powderMolecular weight:222.28g/mol3,5-Diisopropylsalicylic acid
CAS:3,5-Diisopropylsalicylic acid is a reactive chemical substance that has been shown to be an effective anti-inflammatory agent. The compound is active against wild-type viruses and copper complexes. 3,5-Diisopropylsalicylic acid also has been shown to inhibit the growth of human cancer cells in vitro. This drug can be used as an analytical reagent for the detection of water vapor in gas chromatography and other techniques. The acute toxicities associated with 3,5-diisopropylsalicylic acid are not well understood, but it has been shown to have a negative effect on body mass index. It also may affect pluripotent cells and radiation therapy. There are reports of drug interactions when used with certain medications such as acetaminophen or ibuprofen.Formula:C13H18O3Purity:Min. 95%Color and Shape:PowderMolecular weight:222.28 g/mol3,5-Diisopropylsalicylic Acid
CAS:Controlled Product<p>Applications 3,5-Diisopropylsalicylic Acid is used in preparation of Benzamides as LRH-1 modulators.<br>References England, Pamela M., et al.: PCT Int. Appl., (2017);<br></p>Formula:C13H18O3Color and Shape:NeatMolecular weight:222.28







