CAS 2215-77-2
:4-Phenoxybenzoic acid
Description:
4-Phenoxybenzoic acid, with the CAS number 2215-77-2, is an aromatic carboxylic acid characterized by its phenoxy and benzoic acid functional groups. It appears as a white to off-white crystalline solid and is known for its moderate solubility in organic solvents such as ethanol and acetone, while being less soluble in water. The compound exhibits a melting point that is typical for similar aromatic acids, indicating its solid state at room temperature. 4-Phenoxybenzoic acid is utilized in various applications, including as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and dyes. Its structure allows for potential interactions in biological systems, making it of interest in medicinal chemistry. Additionally, it may exhibit properties such as antimicrobial or anti-inflammatory activity, although specific biological effects can vary based on concentration and formulation. Safety data indicates that, like many organic compounds, it should be handled with care to avoid skin and eye irritation.
Formula:C13H10O3
InChI:InChI=1S/C13H10O3/c14-13(15)10-6-8-12(9-7-10)16-11-4-2-1-3-5-11/h1-9H,(H,14,15)
InChI key:InChIKey=RYAQFHLUEMJOMF-UHFFFAOYSA-N
SMILES:O(C1=CC=C(C(O)=O)C=C1)C2=CC=CC=C2
Synonyms:- 4-Carboxydiphenyl ether
- 4-Phenoxy benzoic acid
- 4-Phenoxybenzoate
- Benzoic acid, 4-phenoxy-
- Benzoic acid, p-phenoxy-
- NSC 246039
- p-Phenoxybenzoic acid
- 4-Phenoxybenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
4-Phenoxybenzoic Acid
CAS:Formula:C13H10O3Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:214.224-Phenoxybenzoic acid, 99%
CAS:4-Phenoxybenzoic acid can block DNA binding of the human papillomarvirus (HPV) E2 protein. It is employed as an intermediate of Sitafloxacin, which is a fluoroquinolone antibiotic that shows promise in the treatment of Buruli ulcer. This Thermo Scientific Chemicals brand product was originally part
Formula:C13H10O3Purity:99%Color and Shape:White to cream, Crystals or powder or crystalline powderMolecular weight:214.224-Phenoxybenzoic acid
CAS:4-Phenoxybenzoic acidFormula:C13H10O3Purity:≥95%Color and Shape: faint beige crystalline powderMolecular weight:214.22g/mol4-Phenoxybenzoic acid
CAS:Formula:C13H10O3Color and Shape:White to off-white crystalline powderMolecular weight:214.224-Phenoxybenzoic acid
CAS:Intermediate in the synthesis of ibrutinib
Formula:C13H10O3Purity:Min. 95%Color and Shape:PowderMolecular weight:214.22 g/mol








