CAS 221564-97-2

α,α,4-Trichlorobenzenedodecanoic acid

Description:

α,α,4-Trichlorobenzenedodecanoic acid is a synthetic organic compound characterized by its unique structure, which includes a dodecanoic acid chain and three chlorine atoms substituted on a benzene ring. This compound is part of a class of chlorinated aromatic acids, which are known for their potential applications in various industrial processes, including as intermediates in the synthesis of other chemicals. The presence of chlorine atoms enhances the hydrophobicity and stability of the molecule, which can influence its behavior in environmental contexts. Typically, such compounds may exhibit low solubility in water but higher solubility in organic solvents. The compound's properties, such as melting point, boiling point, and reactivity, are influenced by the chlorination pattern and the length of the aliphatic chain. Additionally, due to the presence of chlorine, there may be concerns regarding its environmental persistence and potential toxicity, necessitating careful handling and assessment in accordance with safety regulations. Overall, α,α,4-Trichlorobenzenedodecanoic acid represents a complex interaction of organic chemistry and environmental science.

Formula: C₁₈H₂₅Cl₃O₂

InChI: InChI=1S/C18H25Cl3O2/c19-16-12-10-15(11-13-16)9-7-5-3-1-2-4-6-8-14-18(20,21)17(22)23/h10-13H,1-9,14H2,(H,22,23)

InChI key: InChIKey=GPCJDSXBRMKASP-UHFFFAOYSA-N

SMILES: C(CCCCCCCCCC(C(O)=O)(Cl)Cl)C1=CC=C(Cl)C=C1

Synonyms:

• Benzenedodecanoic acid, α,α,4-trichloro-
• BM 170744
• K 111
• K 111 (pharmaceutical)
• α,α,4-Trichlorobenzenedodecanoic acid

K-111

CAS: 221564-97-2

K-111

Purity: ≥98%

Molecular weight: 379.75g/mol

Ref: 54-BUP02766

K-111

CAS: 221564-97-2

K-111 is a PPAR alpha agonist. K-111 improves insulin resistance, reducing bodyweight, and ameliorating atherogenic dyslipidemia.

Formula: C₁₈H₂₅Cl₃O₂

Purity: 99.64% - 99.88%

Color and Shape: Solid

Molecular weight: 379.75

Ref: TM-T27706