CAS 22162-51-2
:1-(2-Nitrobenzyl)pyrrole-2-carboxaldehyde
Description:
1-(2-Nitrobenzyl)pyrrole-2-carboxaldehyde is an organic compound characterized by its unique structure, which includes a pyrrole ring, a nitrobenzyl group, and an aldehyde functional group. The presence of the nitro group introduces significant electron-withdrawing properties, influencing the compound's reactivity and polarity. This compound typically appears as a solid at room temperature and is soluble in organic solvents such as ethanol and dichloromethane, but may have limited solubility in water due to its hydrophobic characteristics. It is often utilized in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals and agrochemicals. The aldehyde functional group allows for further chemical modifications, making it a versatile intermediate in various synthetic pathways. Additionally, the compound may exhibit interesting biological activities, which can be explored in drug discovery research. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity and reactivity.
Formula:C12H10N2O3
InChI:InChI=1/C12H10N2O3/c15-9-11-5-3-7-13(11)8-10-4-1-2-6-12(10)14(16)17/h1-7,9H,8H2
SMILES:c1ccc(c(c1)Cn1cccc1C=O)N(=O)=O
Synonyms:- 2-Formyl-1-(2-nitrobenzyl)pyrrole
- 1-(2-Nitrophenylmethyl)-2-pyrrolecarboxaldehyde
- 1-(2-nitrobenzyl)-1H-pyrrole-2-carbaldehyde
- 1-(2-Nitrobenzyl)-Pyrrole-2-carboxyaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-(2-Nitrobenzyl)-1H-pyrrole-2-carbaldehyde
CAS:Formula:C12H10N2O3Color and Shape:SolidMolecular weight:230.2194
