CymitQuimica logo

CAS 221654-71-3

:

1-Methylethyl N-[(1R)-1-[[[(1R)-1-(6-fluoro-2-benzothiazolyl)ethyl]amino]carbonyl]-2-methylpropyl]carbamate

Description:
1-Methylethyl N-[(1R)-1-[[[(1R)-1-(6-fluoro-2-benzothiazolyl)ethyl]amino]carbonyl]-2-methylpropyl]carbamate, with CAS number 221654-71-3, is a chemical compound characterized by its complex structure, which includes a carbamate functional group and a benzothiazole moiety. This compound is typically classified as a pharmaceutical agent, often investigated for its potential therapeutic applications. Its molecular structure suggests it may exhibit specific biological activities, potentially related to its interactions with biological targets. The presence of a fluorine atom in the benzothiazole ring may enhance its pharmacological properties, such as lipophilicity or metabolic stability. Additionally, the stereochemistry indicated by the (1R) configurations suggests that the compound may exhibit chirality, which can influence its biological activity and interactions. Overall, this compound's unique structural features contribute to its potential utility in medicinal chemistry and drug development, although specific biological effects and mechanisms would require further empirical investigation.
Formula:C18H24FN3O3S
InChI:InChI=1S/C18H24FN3O3S/c1-9(2)15(22-18(24)25-10(3)4)16(23)20-11(5)17-21-13-7-6-12(19)8-14(13)26-17/h6-11,15H,1-5H3,(H,20,23)(H,22,24)/t11-,15-/m1/s1
InChI key:InChIKey=USRKFGIXLGKMKU-IAQYHMDHSA-N
SMILES:[C@@H](NC([C@H](NC(OC(C)C)=O)[C@@H](C)C)=O)(C)C=1SC=2C(N1)=CC=C(F)C2
Synonyms:
  • 1-Methylethyl N-[(1R)-1-[[[(1R)-1-(6-fluoro-2-benzothiazolyl)ethyl]amino]carbonyl]-2-methylpropyl]carbamate
  • Carbamic acid, [(1R)-1-[[[(1R)-1-(6-fluoro-2-benzothiazolyl)ethyl]amino]carbonyl]-2-methylpropyl]-, 1-methylethyl ester
  • Carbamic acid, N-[(1R)-1-[[[(1R)-1-(6-fluoro-2-benzothiazolyl)ethyl]amino]carbonyl]-2-methylpropyl]-, 1-methylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.