CAS 221664-05-7
:2,3-Dinor-8-isoPGF2α
Description:
2,3-Dinor-8-isoPGF2α is a synthetic prostaglandin analog that is derived from the metabolism of prostaglandin F2α (PGF2α). It is characterized by its unique structure, which includes modifications to the prostaglandin backbone that enhance its biological activity and stability. This compound is known for its potent vasodilatory effects and its role in various physiological processes, including inflammation and reproductive functions. It is often studied for its potential therapeutic applications, particularly in cardiovascular and reproductive health. The compound is typically used in research settings to explore its effects on smooth muscle contraction and its interactions with specific receptors. Additionally, 2,3-Dinor-8-isoPGF2α may exhibit varying degrees of activity depending on the biological context, making it a valuable tool for understanding prostaglandin signaling pathways. As with many prostaglandin derivatives, its stability and solubility can influence its bioavailability and efficacy in biological systems.
Formula:C18H30O5
InChI:InChI=1S/C18H30O5/c1-2-3-4-7-13(19)10-11-15-14(16(20)12-17(15)21)8-5-6-9-18(22)23/h5-6,10-11,13-17,19-21H,2-4,7-9,12H2,1H3,(H,22,23)/b6-5-,11-10+/t13-,14-,15+,16-,17+/m0/s1
InChI key:InChIKey=IDKLJIUIJUVJNR-JSEKUSAISA-N
SMILES:C(/C=C\CC(O)=O)[C@H]1[C@@H](/C=C/[C@H](CCCCC)O)[C@H](O)C[C@@H]1O
Synonyms:- 2,3-Dinor iPF2α-III
- 3-Pentenoic acid, 5-[(1S,2R,3R,5S)-3,5-dihydroxy-2-[(1E,3S)-3-hydroxy-1-octenyl]cyclopentyl]-, (3Z)-
- 2,3-Dinor-8-isoPGF2α
- 3-Pentenoic acid, 5-[(1S,2R,3R,5S)-3,5-dihydroxy-2-[(1E,3S)-3-hydroxy-1-octen-1-yl]cyclopentyl]-, (3Z)-
- (3Z)-5-[(1S,2R,3R,5S)-3,5-Dihydroxy-2-[(1E,3S)-3-hydroxy-1-octen-1-yl]cyclopentyl]-3-pentenoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
2,3-Dinor iPF2α-III
CAS:Controlled ProductFormula:C18H30O5Color and Shape:NeatMolecular weight:326.4282,3-dinor-8-iso Prostaglandin F2α
CAS:8-isoProstaglandin F2α (8-isoPGF2α; 8-isoprostane) is a byproduct of non-specific lipid peroxidation, resembling prostaglandin in structure. In humans and rats, its metabolite, 12,3-dinor-8-isoPGF2α, is formed following exogenous administration of 8-isoPGF2α, which is converted to 2,3-dinor-8-isoPGF1α and 2,3-dinor-8-isoPGF2α. Additionally, rat hepatocytes can further break down 8-isoPGF2α into a β-oxidation product, 2,3,4,5-tetranor-8-isoPGF2α. The metabolite, 2,3-dinor-8-isoPGF2α, is normally found in human urine at concentrations of 200-300 pg/ml. Its levels rise in conditions associated with oxidative stress, such as smoking, demonstrating a correlation with the concentration of its precursor, 8-isoPGF2α.Formula:C18H30O5Color and Shape:SolidMolecular weight:326.42,3-Dinor iPF2α-III-d9
CAS:Controlled ProductFormula:C18D9H21O5Color and Shape:NeatMolecular weight:335.483


