CAS 221675-35-0

ethyl 1H-pyrrolo[2,3-b]pyridine-2-carboxylate

Description:

Ethyl 1H-pyrrolo[2,3-b]pyridine-2-carboxylate is a chemical compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyridine rings. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its bioactive properties. The presence of the ethyl ester functional group contributes to its reactivity and solubility in organic solvents. Ethyl 1H-pyrrolo[2,3-b]pyridine-2-carboxylate may exhibit various biological activities, making it of interest for research in drug discovery. Its molecular structure allows for interactions with biological targets, which can lead to therapeutic effects. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use. Overall, this compound represents a significant area of interest in organic synthesis and pharmacology.

Formula: C₁₀H₁₀N₂O₂

InChI: InChI=1/C10H10N2O2/c1-2-14-10(13)8-6-7-4-3-5-11-9(7)12-8/h3-6H,2H2,1H3,(H,11,12)

SMILES: CCOC(=O)c1cc2cccnc2[nH]1

Synonyms:

• 1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid, ethyl ester
• Ethyl-1H-pyrrolo[2,3-b]pyridin-2-carboxylat

ethyl 1H-pyrrolo[2,3-b]pyridine-2-carboxylate

CAS: 221675-35-0

Formula: C₁₀H₁₀N₂O₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 190.1986

Ref: IN-DA003Q0S

Ethyl 7-azaindole-2-carboxylate

CAS: 221675-35-0

Ethyl 7-azaindole-2-carboxylate

Formula: C₁₀H₁₀N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 190.20g/mol

Ref: 54-OR2140

Ethyl 1H-pyrrolo[2,3-b]pyridine-2-carboxylate

CAS: 221675-35-0

Formula: C₁₀H₁₀N₂O₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 190.202

Ref: 10-F077444