CymitQuimica logo

CAS 221681-84-1

:

1H-Indazol-6-amine,4-chloro-

Description:
1H-Indazol-6-amine, 4-chloro- is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of an amino group (-NH2) at the 6-position and a chlorine atom at the 4-position contributes to its reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amino group. Its molecular structure suggests potential for hydrogen bonding, which can influence its interactions in biological systems. 1H-Indazol-6-amine, 4-chloro- may serve as a building block in the synthesis of various pharmaceuticals or agrochemicals, particularly in the development of compounds targeting specific biological pathways. Additionally, the chlorine substituent can enhance the lipophilicity and bioavailability of derivatives formed from this compound. As with many nitrogen-containing heterocycles, it may also exhibit interesting electronic properties, making it a subject of interest in materials science and organic electronics.
Formula:C7H6ClN3
InChI:InChI=1S/C7H6ClN3/c8-6-1-4(9)2-7-5(6)3-10-11-7/h1-3H,9H2,(H,10,11)
InChI key:CGWACFIMPQAJEH-UHFFFAOYSA-N
SMILES:C1=C(C=C(C2=C1NN=C2)Cl)N
Synonyms:
  • 6-Amino-4-Chloro-1H-Indazole
  • 6-Amino-4-Chloroindazole
Found 4 products.