CAS 2217-35-8
:(Tetrahydro-2-furanyl)methyl 2-hydroxybenzoate
Description:
(Tetrahydro-2-furanyl)methyl 2-hydroxybenzoate, with the CAS number 2217-35-8, is an organic compound characterized by its ester functional group, which is derived from the reaction of a hydroxybenzoic acid and a tetrahydrofuran derivative. This compound typically exhibits a moderate polarity due to the presence of both hydrophilic (hydroxy and ester) and hydrophobic (aromatic and furan) components. It is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the tetrahydrofuran ring contributes to its cyclic structure, which can influence its reactivity and solubility in various solvents. This compound may have applications in the fields of pharmaceuticals, fragrances, or as a chemical intermediate due to its unique structural features. Additionally, its stability and reactivity can be influenced by environmental factors such as temperature and pH, making it important to handle it under controlled conditions.
Formula:C12H14O4
InChI:InChI=1S/C12H14O4/c13-11-6-2-1-5-10(11)12(14)16-8-9-4-3-7-15-9/h1-2,5-6,9,13H,3-4,7-8H2
InChI key:InChIKey=VNDLMXQTZJPTOR-UHFFFAOYSA-N
SMILES:C(OCC1CCCO1)(=O)C2=C(O)C=CC=C2
Synonyms:- (Oxolan-2-yl)methyl 2-hydroxybenzoate
- (Tetrahydro-2-furanyl)methyl 2-hydroxybenzoate
- (Tetrahydrofuran-2-yl)methyl 2-hydroxybenzoate
- 2-Hydroxy-benzoic acid tetrahydro-furan-2-ylmethyl ester
- Benzoic acid, 2-hydroxy-, (tetrahydro-2-furanyl)methyl ester
- NSC 68484
- Salicylic acid, tetrahydrofurfuryl ester
- Tetrahydrofuran-2-Ylmethyl 2-Hydroxybenzoate
- Tetrahydrofurfuryl salicylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Thurfyl Salicylate
CAS:Thurfyl Salicylate treats joint, muscle, and soft tissue pain, reducing redness.Formula:C12H14O4Color and Shape:SolidMolecular weight:222.24
