CAS 22172-15-2

Norswertianin

Description:

Norswertianin, with the CAS number 22172-15-2, is a chemical compound that belongs to the class of natural products known as flavonoids. It is primarily derived from various plant sources and is characterized by its polyphenolic structure, which contributes to its antioxidant properties. Norswertianin exhibits a range of biological activities, including anti-inflammatory, antimicrobial, and potential anticancer effects, making it of interest in pharmacological research. The compound is typically soluble in organic solvents and may have limited solubility in water, which is common for many flavonoids. Its stability can be influenced by factors such as pH and light exposure. As a natural product, norswertianin may also play a role in plant defense mechanisms and contribute to the color and flavor of the plants from which it is derived. Further studies are ongoing to fully elucidate its mechanisms of action and potential therapeutic applications.

Formula: C₁₃H₈O₆

InChI: InChI=1S/C13H8O6/c14-5-3-7(16)10-9(4-5)19-8-2-1-6(15)12(17)11(8)13(10)18/h1-4,14-17H

InChI key: InChIKey=RVOUOPDWADMVBA-UHFFFAOYSA-N

SMILES: O=C1C=2C(OC=3C1=C(O)C(O)=CC3)=CC(O)=CC2O

Synonyms:

• 9H-Xanthen-9-one, 1,2,6,8-tetrahydroxy-
• Xanthen-9-one, 1,2,6,8-tetrahydroxy-
• 1,2,6,8-Tetrahydroxy-9H-xanthen-9-one
• Norswertianin
• 1,3,7,8-Tetrahydroxyxanthone

Norswertianin

CAS: 22172-15-2

Norswertianin is a flavonoid derivative, which is a naturally occurring compound derived from the plant genus Swertia. Its source is primarily botanical, with extraction typically occurring from specific species found in alpine and subalpine regions. The mode of action for Norswertianin involves the modulation of various biochemical pathways, particularly those related to inflammation and oxidative stress. It exerts its effects by interfering with the pathways that involve inflammatory mediators and reactive oxygen species, thereby demonstrating potential anti-inflammatory and antioxidant effects.

Formula: C₁₃H₈O₆

Purity: Min. 95%

Molecular weight: 260.2 g/mol

Ref: 3D-XAA17215

Norswertianin

CAS: 22172-15-2

Norswertianin, a xanthone, induces GBM cell differentiation and autophagy via oxidative stress and Akt/mTOR.

Formula: C₁₃H₈O₆

Color and Shape: Solid

Molecular weight: 260.2

Ref: TM-T72904