CAS 22179-31-3

4-[(4-chloro-3-nitrophenyl)sulfonyl]morpholine

Description:

4-[(4-chloro-3-nitrophenyl)sulfonyl]morpholine, with the CAS number 22179-31-3, is a chemical compound characterized by its sulfonamide functional group and a morpholine ring. This compound features a chloro and nitro substituent on the aromatic ring, which can influence its reactivity and biological activity. The presence of the sulfonyl group enhances its solubility in polar solvents, making it useful in various chemical applications. Morpholine, a cyclic amine, contributes to the compound's potential as a building block in pharmaceuticals and agrochemicals. The specific arrangement of functional groups suggests that it may exhibit interesting pharmacological properties, possibly acting as an inhibitor or modulator in biological systems. Additionally, the compound's structural features may allow for interactions with specific biological targets, making it a candidate for further research in medicinal chemistry. Safety and handling precautions should be observed due to the presence of chlorine and nitro groups, which can pose health risks.

Formula: C₁₀H₁₁ClN₂O₅S

InChI: InChI=1/C10H11ClN2O5S/c11-9-2-1-8(7-10(9)13(14)15)19(16,17)12-3-5-18-6-4-12/h1-2,7H,3-6H2

SMILES: c1cc(c(cc1S(=O)(=O)N1CCOCC1)N(=O)=O)Cl

Synonyms:

• 4-(4-Chloro-3-nitro-benzenesulfonyl)-morpholine
• Morpholine, 4-[(4-chloro-3-nitrophenyl)sulfonyl]-
• 4-[(4-Chloro-3-nitrophenyl)sulfonyl]morpholine

4-(4-Chloro-3-nitro-benzenesulfonyl)-morpholine

CAS: 22179-31-3

Formula: C₁₀H₁₁ClN₂O₅S

Molecular weight: 306.7227

Ref: IN-DA007P8N

4-[(4-chloro-3-nitrophenyl)sulphonyl]morpholine

CAS: 22179-31-3

4-[(4-chloro-3-nitrophenyl)sulphonyl]morpholine

Purity: ≥95%

Molecular weight: 306.72g/mol

Ref: 54-OR24147

4-(4-Chloro-3-nitro-benzenesulfonyl)-morpholine

CAS: 22179-31-3

Versatile small molecule scaffold

Formula: C₁₀H₁₁ClN₂O₅S

Purity: Min. 95%

Molecular weight: 306.73 g/mol

Ref: 3D-XAA17931