CAS 22180-01-4

4-(3-methylphenoxy)butanoate

Description:

4-(3-Methylphenoxy)butanoate, identified by its CAS number 22180-01-4, is an organic compound that belongs to the class of esters. It features a butanoate moiety, which is derived from butanoic acid, and is substituted with a 3-methylphenoxy group. This structure imparts specific characteristics to the compound, including its potential solubility in organic solvents and its moderate polarity. The presence of the aromatic ring contributes to its stability and may influence its reactivity, making it suitable for various applications in organic synthesis and potentially in pharmaceuticals or agrochemicals. The compound's molecular structure suggests it may exhibit interesting biological activities, although specific biological properties would require empirical investigation. Additionally, its synthesis typically involves esterification reactions, which are common in organic chemistry for forming esters from carboxylic acids and alcohols. Overall, 4-(3-methylphenoxy)butanoate is a compound of interest in chemical research, particularly in the fields of medicinal chemistry and materials science.

Formula: C₁₁H₁₃O₃

InChI: InChI=1/C11H14O3/c1-9-4-2-5-10(8-9)14-7-3-6-11(12)13/h2,4-5,8H,3,6-7H2,1H3,(H,12,13)/p-1

SMILES: Cc1cccc(c1)OCCCC(=O)O

Synonyms:

• 4-m-Tolyloxy-butyric acid
• Butanoic Acid, 4-(3-Methylphenoxy)-

4-(3-Methylphenoxy)butanoic acid

Controlled Product

CAS: 22180-01-4

Versatile small molecule scaffold

Formula: C₁₁H₁₄O₃

Purity: Min. 95%

Molecular weight: 194.23 g/mol

Ref: 3D-XAA18001