CAS 22180-03-6

4-(3,4-Dimethylphenoxy)butanoic acid

Description:

4-(3,4-Dimethylphenoxy)butanoic acid is an organic compound characterized by its aromatic and carboxylic acid functional groups. It features a butanoic acid backbone, which contributes to its potential as a fatty acid derivative. The presence of the 3,4-dimethylphenoxy group indicates that it has a substituted phenol structure, which can influence its solubility, reactivity, and biological activity. This compound is likely to exhibit moderate polarity due to the carboxylic acid group, making it soluble in polar solvents while retaining some hydrophobic characteristics from the aromatic ring. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as a biochemical probe, although specific applications would depend on further research into its properties and interactions. Additionally, the compound may exhibit specific biological activities, which could be of interest in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, particularly those with potential biological activity.

Formula: C₁₂H₁₆O₃

InChI: InChI=1S/C12H16O3/c1-9-5-6-11(8-10(9)2)15-7-3-4-12(13)14/h5-6,8H,3-4,7H2,1-2H3,(H,13,14)

InChI key: InChIKey=XCDOHVHQWSFAEN-UHFFFAOYSA-N

SMILES: O(CCCC(O)=O)C1=CC(C)=C(C)C=C1

Synonyms:

• Butanoic acid, 4-(3,4-dimethylphenoxy)-
• 4-(3,4-Dimethylphenoxy)butanoic acid
• Butyric acid, 4-(3,4-xylyloxy)-

4-(3,4-Dimethylphenoxy)butanoic acid

Controlled Product

CAS: 22180-03-6

Versatile small molecule scaffold

Formula: C₁₂H₁₆O₃

Purity: Min. 95%

Molecular weight: 208.25 g/mol

Ref: 3D-XAA18003