CAS 22190-35-8

6-bromo-1,2,3,4-tetrahydroquinoline

Description:

6-Bromo-1,2,3,4-tetrahydroquinoline is a bicyclic organic compound characterized by its fused ring structure, which includes a quinoline moiety with a bromine substituent at the 6-position. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its potential applications in medicinal chemistry, particularly as a building block in the synthesis of various pharmaceuticals and biologically active compounds. The presence of the bromine atom can influence its reactivity and biological activity, making it a subject of interest in drug development. Additionally, 6-bromo-1,2,3,4-tetrahydroquinoline may exhibit specific physical properties such as solubility in organic solvents and varying melting and boiling points, which are influenced by its molecular structure. Safety data indicates that, like many brominated compounds, it should be handled with care due to potential toxicity and environmental impact. Overall, this compound represents a valuable entity in organic synthesis and medicinal chemistry research.

Formula: C₉H₁₀BrN

InChI: InChI=1/C9H10BrN/c10-8-3-4-9-7(6-8)2-1-5-11-9/h3-4,6,11H,1-2,5H2

SMILES: C1Cc2cc(ccc2NC1)Br

Synonyms:

• Quinoline, 6-Bromo-1,2,3,4-Tetrahydro-

6-bromo-1,2,3,4-tetrahydroquinoline

CAS: 22190-35-8

Formula: C₉H₁₀BrN

Purity: 96%

Color and Shape: Solid

Molecular weight: 212.0864

Ref: IN-DA003966

6-Bromo-1,2,3,4-tetrahydroquinoline

CAS: 22190-35-8

6-Bromo-1,2,3,4-tetrahydroquinoline

Formula: C₉H₁₀BrN

Purity: 99%

Color and Shape: light yellow to brown low melting solid

Molecular weight: 212.0864g/mol

Ref: 54-OR301104

6-Bromo-1,2,3,4-tetrahydroquinoline

CAS: 22190-35-8

Formula: C₉H₁₀BrN

Purity: 96%

Color and Shape: Solid

Molecular weight: 212.09

Ref: 10-F067511