CAS 22194-38-3
:2,2'-disulfanediylbis(N,N-diethylethanamine) dihydrochloride
Description:
2,2'-Disulfanediylbis(N,N-diethylethanamine) dihydrochloride, with CAS number 22194-38-3, is a chemical compound characterized by its dual amine structure linked by a disulfide bond. This compound features two N,N-diethylethanamine groups, which contribute to its amine functionality and potential for forming hydrogen bonds. The presence of dihydrochloride indicates that the compound exists as a salt, enhancing its solubility in polar solvents, particularly water. The disulfide linkage imparts unique redox properties, making it relevant in various biochemical applications, including as a reducing agent or in the synthesis of other compounds. Its molecular structure suggests potential applications in medicinal chemistry, particularly in drug design or as a reagent in organic synthesis. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its handling and application. Overall, this compound exemplifies the intersection of organic chemistry and biochemistry, with implications for research and industrial applications.
Formula:C12H30Cl2N2S2
InChI:InChI=1/C12H28N2S2.2ClH/c1-5-13(6-2)9-11-15-16-12-10-14(7-3)8-4;;/h5-12H2,1-4H3;2*1H
SMILES:CCN(CC)CCSSCCN(CC)CC.Cl.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Tetraethylcystamine Dihydrochloride (2,2'''-Dithiobis(triethylamine) dihydrochloride)
CAS:Organo-sulfur compounds, nesoiFormula:C12H30Cl2N2S2Color and Shape:White Off-White SolidMolecular weight:336.122752,2'-(Disulfane-1,2-diyl)bis(N,N-diethylethanamine) Dihydrochloride
CAS:Formula:C12H28N2S2ClHColor and Shape:NeatMolecular weight:337.42


