CAS 22203-98-1

5-chloro-N-(3-chlorophenyl)-2-hydroxybenzamide

Description:

5-Chloro-N-(3-chlorophenyl)-2-hydroxybenzamide, with the CAS number 22203-98-1, is an organic compound characterized by its structural features, which include a benzamide core substituted with a hydroxyl group and two chlorine atoms. The presence of the hydroxyl group (–OH) contributes to its potential as a phenolic compound, influencing its solubility and reactivity. The chlorine substituents enhance its lipophilicity and may affect its biological activity, making it of interest in pharmaceutical and agrochemical research. This compound may exhibit various properties such as antimicrobial or anti-inflammatory activities, depending on its specific interactions with biological targets. Its molecular structure suggests it could participate in hydrogen bonding due to the hydroxyl group, which may also influence its melting point and boiling point. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the chlorine atoms, which can act as electron-withdrawing groups. Overall, 5-chloro-N-(3-chlorophenyl)-2-hydroxybenzamide is a compound of interest in various chemical and biological applications.

Formula: C₁₃H₉Cl₂NO₂

InChI: InChI=1/C13H9Cl2NO2/c14-8-2-1-3-10(6-8)16-13(18)11-7-9(15)4-5-12(11)17/h1-7,17H,(H,16,18)

SMILES: c1cc(cc(c1)N=C(c1cc(ccc1O)Cl)O)Cl

Synonyms:

• Benzamide, 5-chloro-N-(3-chlorophenyl)-2-hydroxy-

Benzamide,5-chloro-N-(3-chlorophenyl)-2-hydroxy-

CAS: 22203-98-1

Formula: C₁₃H₉Cl₂NO₂

Purity: 99%

Molecular weight: 282.1221

Ref: IN-DA007P7X

SARS-CoV-2-IN-14

CAS: 22203-98-1

SARS-CoV-2-IN-14

Purity: ≥98%

Molecular weight: 282.12g/mol

Ref: 54-BUP13745

SARS-CoV-2-IN-14

CAS: 22203-98-1

SARS-CoV-2-IN-14 is a potent and oral inhibitor of SARS-CoV-2 (IC50:0.39 μM), which is an analogue of niclosamide.

Formula: C₁₃H₉Cl₂NO₂

Purity: 99.78%

Color and Shape: Solid

Molecular weight: 282.12

Ref: TM-T60538