CAS 222030-63-9
:Combretastatin A4 phosphate
Description:
Combretastatin A4 phosphate is a synthetic derivative of combretastatin A4, which is a natural product derived from the bark of the African willow tree, Combretum caffrum. This compound is primarily known for its potent anti-cancer properties, particularly its ability to inhibit tubulin polymerization, leading to disruption of the microtubule network in cancer cells. As a phosphate prodrug, Combretastatin A4 phosphate is designed to enhance solubility and bioavailability, facilitating its use in therapeutic applications. It is typically administered intravenously and has shown promise in preclinical and clinical studies for treating various solid tumors. The compound is characterized by its ability to induce tumor vascular collapse, thereby starving tumors of their blood supply. Additionally, it has a relatively low toxicity profile compared to traditional chemotherapeutics, making it an attractive candidate for cancer treatment. However, ongoing research is necessary to fully understand its pharmacokinetics, optimal dosing regimens, and potential side effects in diverse patient populations.
Formula:C18H21O8P
InChI:InChI=1S/C18H21O8P/c1-22-14-8-7-12(9-15(14)26-27(19,20)21)5-6-13-10-16(23-2)18(25-4)17(11-13)24-3/h5-11H,1-4H3,(H2,19,20,21)/b6-5-
InChI key:InChIKey=WDOGQTQEKVLZIJ-WAYWQWQTSA-N
SMILES:O(P(=O)(O)O)C1=C(OC)C=CC(/C=C\C2=CC(OC)=C(OC)C(OC)=C2)=C1
Synonyms:- Fosbretabulin
- Combretastatin A4 phosphate
- Phenol, 2-methoxy-5-[(1Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]-, 1-(dihydrogen phosphate)
- Combretastatin A-4P
- Phenol, 2-methoxy-5-[(1Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]-, dihydrogen phosphate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(Z)-2-Methoxy-5-(3,4,5-trimethoxystyryl)phenyl dihydrogen phosphate
CAS:Formula:C18H21O8PMolecular weight:396.3283Fosbretabulin [free base]
CAS:Fosbretabulin is a natural cis-stilbene that interferes with cellular tubulin dynamics and selectively destroys tumor blood vessels.
Formula:C18H21O8PColor and Shape:SolidMolecular weight:396.332-Methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl dihydrogen phosphate
CAS:2-Methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl dihydrogen phosphate is a phosphorylated derivative of a stilbene compound, functioning as a potent chemical agent. This compound is synthesized through organic chemistry techniques, starting from its stilbene precursor, which is modified to incorporate phosphorus groups. This specific alteration enhances its biochemical stability and solubility, making it a suitable candidate for various scientific applications.Formula:C18H21O8PPurity:Min. 95%Molecular weight:396.3 g/mol


